Ampicillin sodium and sulbactam sodium
(KMEGBUCIGMEPME-LQYKFRDPSA-N)
Structure
- SMILES
- N[C@H](c1ccccc1)C(=O)N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C.OC(=O)[C@@H]1C2C(=O)C[C@H]2S(=O)(=O)C1(C)C
- Molecular Formula:
- C25H31N3O9S2
- Molecular Weight:
- 581.658
- Log P:
- 2.2798
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 4
- TPSA:
- 234.92
- CAS Number(s):
- 94935-63-4
Synonym(s)
1.
Ampicillin sodium and sulbactam sodium
External Link(s)
| PubChem Compound | 119561 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Klebsiella test positive | FAERS: 6 | US FAERS | |
| 2 | Vomiting | FAERS: 5 | US FAERS | |
| 3 | Quadriparesis | FAERS: 4 | US FAERS | |
| 4 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 5 | Angioedema | FAERS: 3 | US FAERS | |
| 6 | Autoimmune thyroiditis | FAERS: 3 | US FAERS | |
| 7 | Clostridium test positive | FAERS: 3 | US FAERS | |
| 8 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 9 | Drug ineffective | FAERS: 2 | US FAERS | |
| 10 | Fatigue | FAERS: 2 | US FAERS | |
| 11 | Headache | FAERS: 2 | US FAERS | |
| 12 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 13 | Palpitations | FAERS: 2 | US FAERS | |
| 14 | Pruritus | FAERS: 2 | US FAERS | |
| 15 | Shock | FAERS: 2 | US FAERS | |
| 16 | Urticaria | FAERS: 2 | US FAERS | |
| 17 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 18 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 19 | Anxiety | FAERS: 1 | US FAERS | |
| 20 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 21 | Asthenia | FAERS: 1 | US FAERS | |
| 22 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 23 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 24 | Blood urea increased | FAERS: 1 | US FAERS | |
| 25 | Bradycardia | FAERS: 1 | US FAERS | |
| 26 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 27 | Chills | FAERS: 1 | US FAERS | |
| 28 | Cholestasis | FAERS: 1 | US FAERS | |
| 29 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 30 | Cyanosis | FAERS: 1 | US FAERS | |
| 31 | Dehydration | FAERS: 1 | US FAERS | |
| 32 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 33 | Erythema | FAERS: 1 | US FAERS | |
| 34 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 35 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 36 | Hepatitis | FAERS: 1 | US FAERS | |
| 37 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 38 | Hypotension | FAERS: 1 | US FAERS | |
| 39 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 40 | Injection site pain | FAERS: 1 | US FAERS | |
| 41 | Lethargy | FAERS: 1 | US FAERS | |
| 42 | Leukocytosis | FAERS: 1 | US FAERS | |
| 43 | Memory impairment | FAERS: 1 | US FAERS | |
| 44 | Nausea | FAERS: 1 | US FAERS | |
| 45 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 46 | Pain | FAERS: 1 | US FAERS | |
| 47 | Pancytopenia | FAERS: 1 | US FAERS | |
| 48 | Papule | FAERS: 1 | US FAERS | |
| 49 | Parotitis | FAERS: 1 | US FAERS | |
| 50 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 51 | Product preparation error | FAERS: 1 | US FAERS | |
| 52 | Rash erythematous | FAERS: 1 | US FAERS | |
| 53 | Respiratory distress | FAERS: 1 | US FAERS | |
| 54 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 55 | Syncope | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.