dalbavancin
(KGPGQDLTDHGEGT-SZUNQUCBSA-N)
Structure
- SMILES
- OC[C@H]1O[C@H](Oc2cc(O)cc3c2c2cc(ccc2O)[C@H]2NC(=O)[C@@H]4NC(=O)[C@H]5NC(=O)[C@@H](Cc6ccc(Oc7cc4cc(Oc4ccc([C@H]([C@@H](C(=O)N[C@@H]3C(=O)NCCCN(C)C)NC2=O)O)cc4Cl)c7O[C@@H]2O[C@H](C(=O)O)[C@H]([C@@H]([C@H]2NC(=O)CCCCCCCCC(C)C)O)O)cc6)NC(=O)[C@H](NC)c2cc(Oc3cc5c(Cl)c(c3)O)c(O)cc2)[C@H]([C@H]([C@@H]1O)O)O
- Molecular Formula:
- C88H100Cl2N10O28
- Molecular Weight:
- 1816.690
- Log P:
- 7.3135
- Hydrogen Bond Acceptor:
- 38
- Hydrogen Bond Donor:
- 21
- TPSA:
- 572.51
- CAS Number(s):
- N/A
Synonym(s)
1.
dalbavancin
2.
Dalvance
3.
Xydalba
External Link(s)
| MeSH | C469289 |
| PubChem Compound | 16134627 |
| ChEBI | 82721 |
| CHEMBL | CHEMBL3301669 |
| DrugCentral | 777 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Hypersensitivity | FAERS: 20 | US FAERS | |
| 2 | Back Pain | FAERS: 17 | US FAERS | |
| 3 | Pruritus | FAERS: 15 | US FAERS | |
| 4 | Drug ineffective | FAERS: 12 | US FAERS | |
| 5 | Chest discomfort | FAERS: 11 | US FAERS | |
| 6 | Erythema | FAERS: 10 | US FAERS | |
| 7 | Urticaria | FAERS: 9 | US FAERS | |
| 8 | Nausea | FAERS: 8 | US FAERS | |
| 9 | Chills | FAERS: 7 | US FAERS | |
| 10 | Infusion Site Extravasation | FAERS: 7 | US FAERS | |
| 11 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 12 | Chest Pain | FAERS: 5 | US FAERS | |
| 13 | Flushing | FAERS: 5 | US FAERS | |
| 14 | Arthralgia | FAERS: 3 | US FAERS | |
| 15 | Asthenia | FAERS: 3 | US FAERS | |
| 16 | Flank Pain | FAERS: 3 | US FAERS | |
| 17 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 18 | Infusion site swelling | FAERS: 3 | US FAERS | |
| 19 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 20 | Sepsis | FAERS: 3 | US FAERS | |
| 21 | Throat irritation | FAERS: 3 | US FAERS | |
| 22 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 23 | Discomfort | FAERS: 2 | US FAERS | |
| 24 | Dizziness | FAERS: 2 | US FAERS | |
| 25 | Drug dose omission | FAERS: 2 | US FAERS | |
| 26 | Extravasation | FAERS: 2 | US FAERS | |
| 27 | Gangrene | FAERS: 2 | US FAERS | |
| 28 | Headache | FAERS: 2 | US FAERS | |
| 29 | Infusion site reaction | FAERS: 2 | US FAERS | |
| 30 | Injection site pain | FAERS: 2 | US FAERS | |
| 31 | Injection site warmth | FAERS: 2 | US FAERS | |
| 32 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 33 | Pain | FAERS: 2 | US FAERS | |
| 34 | Poor quality product administered | FAERS: 2 | US FAERS | |
| 35 | Product preparation error | FAERS: 2 | US FAERS | |
| 36 | Product reconstitution quality issue | FAERS: 2 | US FAERS | |
| 37 | Swelling | FAERS: 2 | US FAERS | |
| 38 | Vomiting | FAERS: 2 | US FAERS | |
| 39 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 40 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 41 | Angioedema | FAERS: 1 | US FAERS | |
| 42 | Anxiety | FAERS: 1 | US FAERS | |
| 43 | Application site streaking | FAERS: 1 | US FAERS | |
| 44 | Application site urticaria | FAERS: 1 | US FAERS | |
| 45 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 46 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 47 | Blood urine present | FAERS: 1 | US FAERS | |
| 48 | Cellulitis | FAERS: 1 | US FAERS | |
| 49 | Constipation | FAERS: 1 | US FAERS | |
| 50 | Cyanosis | FAERS: 1 | US FAERS | |
| 51 | Ecchymosis | FAERS: 1 | US FAERS | |
| 52 | Expired product administered | FAERS: 1 | US FAERS | |
| 53 | Feeling Cold | FAERS: 1 | US FAERS | |
| 54 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 55 | Fluid overload | FAERS: 1 | US FAERS | |
| 56 | Hypokinesia | FAERS: 1 | US FAERS | |
| 57 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 58 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 59 | Infection reactivation | FAERS: 1 | US FAERS | |
| 60 | Inflammation | FAERS: 1 | US FAERS | |
| 61 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 62 | Infusion site irritation | FAERS: 1 | US FAERS | |
| 63 | Infusion site pain | FAERS: 1 | US FAERS | |
| 64 | Infusion site thrombosis | FAERS: 1 | US FAERS | |
| 65 | Infusion site urticaria | FAERS: 1 | US FAERS | |
| 66 | Injection site erythema | FAERS: 1 | US FAERS | |
| 67 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 68 | Lip swelling | FAERS: 1 | US FAERS | |
| 69 | Malaise | FAERS: 1 | US FAERS | |
| 70 | Male Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 71 | Muscle tightness | FAERS: 1 | US FAERS | |
| 72 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 73 | Myalgia | FAERS: 1 | US FAERS | |
| 74 | Neck Pain | FAERS: 1 | US FAERS | |
| 75 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 76 | Pallor | FAERS: 1 | US FAERS | |
| 77 | Palpitations | FAERS: 1 | US FAERS | |
| 78 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 79 | Phlebitis | FAERS: 1 | US FAERS | |
| 80 | Presyncope | FAERS: 1 | US FAERS | |
| 81 | Product prescribing error | FAERS: 1 | US FAERS | |
| 82 | Product storage error | FAERS: 1 | US FAERS | |
| 83 | Shock | FAERS: 1 | US FAERS | |
| 84 | Skin reaction | FAERS: 1 | US FAERS | |
| 85 | Sudden death | FAERS: 1 | US FAERS | |
| 86 | Therapy cessation | FAERS: 1 | US FAERS | |
| 87 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 88 | furuncle | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.