doxylamine succinate
(KBAUFVUYFNWQFM-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)CCC(=O)O.CN(CCOC(c1ccccn1)(c1ccccc1)C)C
- Molecular Formula:
- C21H28N2O5
- Molecular Weight:
- 388.457
- Log P:
- 2.8591
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 2
- TPSA:
- 99.96
- CAS Number(s):
- 562-10-7
Synonym(s)
1.
doxylamine succinate
External Link(s)
| MeSH | C035385 |
| PubChem Compound | 43833352 11224 |
| ChEBI | 82461 |
| CHEMBL | CHEMBL1200392 |
| KEGG | cpd:C19414 dr:D02327 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Overdose | FAERS: 53 | US FAERS | |
| 2 | Somnolence | FAERS: 34 | US FAERS | |
| 3 | Drug ineffective | FAERS: 26 | US FAERS | |
| 4 | Incorrect dose administered | FAERS: 26 | US FAERS | |
| 5 | Suicide attempt | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Dizziness | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Vomiting | FAERS: 15 | US FAERS | |
| 8 | Feeling abnormal | FAERS: 12 | US FAERS | |
| 9 | Tremor | FAERS: 10 | US FAERS | |
| 10 | Rhabdomyolysis | FAERS: 8 | US FAERS | |
| 11 | Agitation | FAERS: 6 | US FAERS | |
| 12 | Drug Dependence | FAERS: 6 | US FAERS | |
| 13 | Drug exposure during pregnancy | FAERS: 6 | US FAERS | |
| 14 | Medication Error | FAERS: 6 | US FAERS | |
| 15 | Mydriasis | FAERS: 6 | US FAERS | |
| 16 | Dysarthria | FAERS: 5 | US FAERS | |
| 17 | Expired product administered | FAERS: 5 | US FAERS | |
| 18 | Fatigue | FAERS: 5 | US FAERS | |
| 19 | Intentional misuse | FAERS: 5 | US FAERS | |
| 20 | Toxicity to various agents | FAERS: 5 | US FAERS | |
| 21 | Anxiety | FAERS: 4 | US FAERS | |
| 22 | Completed Suicide | FAERS: 4 | US FAERS | |
| 23 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 24 | Hypersomnia | FAERS: 4 | US FAERS | |
| 25 | Incorrect drug administration duration | FAERS: 4 | US FAERS | |
| 26 | Lethargy | FAERS: 4 | US FAERS | |
| 27 | Tachycardia | FAERS: 4 | US FAERS | |
| 28 | Accidental exposure | FAERS: 3 | US FAERS | |
| 29 | Accidental overdose | FAERS: 3 | US FAERS | |
| 30 | Amnesia | FAERS: 3 | US FAERS | |
| 31 | Drug screen positive | FAERS: 3 | US FAERS | |
| 32 | Hypotension | FAERS: 3 | US FAERS | |
| 33 | Incoherent | FAERS: 3 | US FAERS | |
| 34 | Intentional drug misuse | FAERS: 3 | US FAERS | |
| 35 | Malaise | FAERS: 3 | US FAERS | |
| 36 | Palpitations | FAERS: 3 | US FAERS | |
| 37 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 38 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 39 | Accidental drug intake by child | FAERS: 2 | US FAERS | |
| 40 | Aphasia | FAERS: 2 | US FAERS | |
| 41 | Asthenia | FAERS: 2 | US FAERS | |
| 42 | Chest Pain | FAERS: 2 | US FAERS | |
| 43 | Disorientation | FAERS: 2 | US FAERS | |
| 44 | Dyspepsia | FAERS: 2 | US FAERS | |
| 45 | Flushing | FAERS: 2 | US FAERS | |
| 46 | Headache | FAERS: 2 | US FAERS | |
| 47 | Leukocytosis | FAERS: 2 | US FAERS | |
| 48 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 49 | Nausea | FAERS: 2 | US FAERS | |
| 50 | Nervousness | FAERS: 2 | US FAERS | |
| 51 | Paranoia | FAERS: 2 | US FAERS | |
| 52 | Pruritus | FAERS: 2 | US FAERS | |
| 53 | Sleep Talking | FAERS: 2 | US FAERS | |
| 54 | Tinnitus | FAERS: 2 | US FAERS | |
| 55 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 56 | Abasia | FAERS: 1 | US FAERS | |
| 57 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 58 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 59 | Anger | FAERS: 1 | US FAERS | |
| 60 | Anticholinergic Syndrome | FAERS: 1 | US FAERS | |
| 61 | Arthralgia | FAERS: 1 | US FAERS | |
| 62 | Back Pain | FAERS: 1 | US FAERS | |
| 63 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 64 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 65 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 66 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 67 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 68 | Blood growth hormone abnormal | FAERS: 1 | US FAERS | |
| 69 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 70 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 71 | Blood pH increased | FAERS: 1 | US FAERS | |
| 72 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 73 | Blood urine present | FAERS: 1 | US FAERS | |
| 74 | Bronchospasm | FAERS: 1 | US FAERS | |
| 75 | Cerebellar Ataxia | FAERS: 1 | US FAERS | |
| 76 | Crying | FAERS: 1 | US FAERS | |
| 77 | Dependence | FAERS: 1 | US FAERS | |
| 78 | Drug abuse | FAERS: 1 | US FAERS | |
| 79 | Drug administration error | FAERS: 1 | US FAERS | |
| 80 | Drug effect variable | FAERS: 1 | US FAERS | |
| 81 | Drug toxicity | FAERS: 1 | US FAERS | |
| 82 | Dysuria | FAERS: 1 | US FAERS | |
| 83 | Emotional disorder | FAERS: 1 | US FAERS | |
| 84 | Epistaxis | FAERS: 1 | US FAERS | |
| 85 | Feeling jittery | FAERS: 1 | US FAERS | |
| 86 | Flatulence | FAERS: 1 | US FAERS | |
| 87 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 88 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 89 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 90 | Hyperventilation | FAERS: 1 | US FAERS | |
| 91 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 92 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 93 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 94 | Mental Retardation | FAERS: 1 | US FAERS | |
| 95 | Middle insomnia | FAERS: 1 | US FAERS | |
| 96 | Mood swings | FAERS: 1 | US FAERS | |
| 97 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 98 | Myalgia | FAERS: 1 | US FAERS | |
| 99 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 100 | Negative thoughts | FAERS: 1 | US FAERS | |
| 101 | Night sweats | FAERS: 1 | US FAERS | |
| 102 | No adverse event | FAERS: 1 | US FAERS | |
| 103 | Nystagmus | FAERS: 1 | US FAERS | |
| 104 | Oliguria | FAERS: 1 | US FAERS | |
| 105 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 106 | Petechiae | FAERS: 1 | US FAERS | |
| 107 | Poisoning | FAERS: 1 | US FAERS | |
| 108 | Product formulation issue | FAERS: 1 | US FAERS | |
| 109 | Proteinuria | FAERS: 1 | US FAERS | |
| 110 | Rash erythematous | FAERS: 1 | US FAERS | |
| 111 | Screaming | FAERS: 1 | US FAERS | |
| 112 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 113 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 114 | Skin reaction | FAERS: 1 | US FAERS | |
| 115 | Snoring | FAERS: 1 | US FAERS | |
| 116 | Somnambulism | FAERS: 1 | US FAERS | |
| 117 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 118 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 119 | Syncope | FAERS: 1 | US FAERS | |
| 120 | Thrombosis | FAERS: 1 | US FAERS | |
| 121 | Tongue biting | FAERS: 1 | US FAERS | |
| 122 | Unevaluable event | FAERS: 1 | US FAERS | |
| 123 | Urinary Retention | FAERS: 1 | US FAERS | |
| 124 | Vascular resistance pulmonary decreased | FAERS: 1 | US FAERS | |
| 125 | Vascular resistance systemic decreased | FAERS: 1 | US FAERS | |
| 126 | Vertigo | FAERS: 1 | US FAERS | |
| 127 | Fatty Liver | 3356310 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.