Ceftazidime sodium
(JEEWDSDYUSEQML-ROMZVAKDSA-M)
Structure
- SMILES
- O=C1[C@@H](NC(=O)/C(=N\OC(C(=O)[O-])(C)C)/c2csc(n2)N)[C@@H]2N1C(=C(CS2)C[n+]1ccccc1)C(=O)[O-].[Na+]
- Molecular Formula:
- C22H21N6NaO7S2
- Molecular Weight:
- 568.558
- Log P:
- -1.7239
- Hydrogen Bond Acceptor:
- 14
- Hydrogen Bond Donor:
- 2
- TPSA:
- 247.59
- CAS Number(s):
- 73547-61-2
Synonym(s)
1.
Ceftazidime sodium
External Link(s)
| PubChem Compound | 5488543 |
| ChEBI | 53675 |
| CHEMBL | CHEMBL1200768 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Syncope | FAERS: 3 | US FAERS | |
| 2 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 3 | Dizziness | FAERS: 2 | US FAERS | |
| 4 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 5 | Injection site pain | FAERS: 2 | US FAERS | |
| 6 | Injection site urticaria | FAERS: 2 | US FAERS | |
| 7 | Status Epilepticus | FAERS: 2 | US FAERS | |
| 8 | prostatitis | FAERS: 2 | US FAERS | |
| 9 | pseudomembranous colitis | FAERS: 2 | US FAERS | |
| 10 | Angioedema | FAERS: 1 | US FAERS | |
| 11 | Bronchospasm | FAERS: 1 | US FAERS | |
| 12 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 13 | Headache | FAERS: 1 | US FAERS | |
| 14 | Hypotension | FAERS: 1 | US FAERS | |
| 15 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 16 | Injection site vasculitis | FAERS: 1 | US FAERS | |
| 17 | Nausea | FAERS: 1 | US FAERS | |
| 18 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 19 | Pruritus | FAERS: 1 | US FAERS | |
| 20 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 21 | Vomiting | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.