indacaterol
(IREJFXIHXRZFER-PCBAQXHCSA-N)
Structure
- SMILES
- OC(=O)/C=C\C(=O)O.CCc1cc2CC(Cc2cc1CC)NC[C@@H](c1ccc(c2c1ccc(=O)[nH]2)O)O
- Molecular Formula:
- C28H32N2O7
- Molecular Weight:
- 508.563
- Log P:
- 3.2516
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 6
- TPSA:
- 159.95
- CAS Number(s):
- 753498-25-8
Synonym(s)
1.
indacaterol
2.
5-(2-(5,6-diethylindan-2-ylamino)-1-hydroxyethyl)-8-hydroxy-1H-quinolin-2-one
3.
Onbrez
4.
QAB-149
5.
arcapta neohaler
External Link(s)
| MeSH | C510790 |
| PubChem Compound | 9827599 |
| ChEBI | 68573 |
| CHEMBL | CHEMBL1789842 |
| KEGG | dr:D09319 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Product use issue | FAERS: 21 | US FAERS | |
| 2 | Malaise | FAERS: 14 | US FAERS | |
| 3 | Pneumonia | FAERS: 14 | US FAERS | |
| 4 | Drug ineffective | FAERS: 7 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 5 | General physical health deterioration | FAERS: 7 | US FAERS | |
| 6 | Deafness | FAERS: 6 | US FAERS | |
| 7 | Fatigue | FAERS: 5 | US FAERS | |
| 8 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 9 | Myocardial Infarction | FAERS: 5 | US FAERS | |
| 10 | Abasia | FAERS: 4 | US FAERS | |
| 11 | Acute respiratory failure | FAERS: 4 | US FAERS | |
| 12 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 13 | Chest discomfort | FAERS: 4 | US FAERS | |
| 14 | Feeling abnormal | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Infarction | FAERS: 4 | US FAERS | |
| 16 | Weight decreased | FAERS: 4 | US FAERS | |
| 17 | Asthenia | FAERS: 3 | US FAERS | |
| 18 | Drug Dependence | FAERS: 3 | US FAERS | |
| 19 | Headache | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Hypotension | FAERS: 3 | US FAERS | |
| 21 | Septic Shock | FAERS: 3 | US FAERS | |
| 22 | Stomatitis | FAERS: 3 | US FAERS | |
| 23 | Tachycardia | FAERS: 3 | US FAERS | |
| 24 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 25 | Agitation | FAERS: 2 | US FAERS | |
| 26 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 27 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 28 | Chest Pain | FAERS: 2 | US FAERS | |
| 29 | Concomitant disease aggravated | FAERS: 2 | US FAERS | |
| 30 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 31 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 32 | Memory impairment | FAERS: 2 | US FAERS | |
| 33 | Palpitations | FAERS: 2 | US FAERS | |
| 34 | Product physical issue | FAERS: 2 | US FAERS | |
| 35 | Productive Cough | FAERS: 2 | US FAERS | |
| 36 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 37 | Thrombosis | FAERS: 2 | US FAERS | |
| 38 | Urticaria | FAERS: 2 | US FAERS | |
| 39 | Vomiting | FAERS: 2 | US FAERS | |
| 40 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 41 | nervous system disorder | FAERS: 2 | US FAERS | |
| 42 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 43 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 44 | Accidental overdose | FAERS: 1 | US FAERS | |
| 45 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 46 | Alopecia | FAERS: 1 | US FAERS | |
| 47 | Anxiety | FAERS: 1 | US FAERS | |
| 48 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 49 | Aphonia | FAERS: 1 | US FAERS | |
| 50 | Arthralgia | FAERS: 1 | US FAERS | |
| 51 | Arthritis | FAERS: 1 | US FAERS | |
| 52 | Asphyxia | FAERS: 1 | US FAERS | |
| 53 | Asthma | FAERS: 1 | US FAERS | |
| 54 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 55 | Blindness | FAERS: 1 | US FAERS | |
| 56 | Bone pain | FAERS: 1 | US FAERS | |
| 57 | Bradycardia | FAERS: 1 | US FAERS | |
| 58 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 59 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 60 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 61 | Bronchitis | FAERS: 1 | US FAERS | |
| 62 | Bronchospasm | FAERS: 1 | US FAERS | |
| 63 | Cataract | FAERS: 1 | US FAERS | |
| 64 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 65 | Choking | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 66 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 67 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 68 | Dementia | FAERS: 1 | US FAERS | |
| 69 | Diaphragmalgia | FAERS: 1 | US FAERS | |
| 70 | Diet refusal | FAERS: 1 | US FAERS | |
| 71 | Disease Progression | FAERS: 1 | US FAERS | |
| 72 | Dizziness | FAERS: 1 | US FAERS | |
| 73 | Drug administration error | FAERS: 1 | US FAERS | |
| 74 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 75 | Erysipelas | FAERS: 1 | US FAERS | |
| 76 | Erythema | FAERS: 1 | US FAERS | |
| 77 | Eye irritation | FAERS: 1 | US FAERS | |
| 78 | Fracture | FAERS: 1 | US FAERS | |
| 79 | Gingivitis | FAERS: 1 | US FAERS | |
| 80 | Glossitis | FAERS: 1 | US FAERS | |
| 81 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 82 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 83 | Laryngitis | FAERS: 1 | US FAERS | |
| 84 | Ligament rupture | FAERS: 1 | US FAERS | |
| 85 | Limb injury | FAERS: 1 | US FAERS | |
| 86 | Lip swelling | FAERS: 1 | US FAERS | |
| 87 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 88 | Malnutrition | FAERS: 1 | US FAERS | |
| 89 | Mastication disorder | FAERS: 1 | US FAERS | |
| 90 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 91 | Myalgia | FAERS: 1 | US FAERS | |
| 92 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 93 | No adverse event | FAERS: 1 | US FAERS | |
| 94 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 95 | Osteoporosis | FAERS: 1 | US FAERS | |
| 96 | Pain | FAERS: 1 | US FAERS | |
| 97 | Pancreatitis | FAERS: 1 | US FAERS | |
| 98 | Pericarditis | FAERS: 1 | US FAERS | |
| 99 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 100 | Post procedural complication | FAERS: 1 | US FAERS | |
| 101 | Product quality issue | FAERS: 1 | US FAERS | |
| 102 | Pseudocyst | FAERS: 1 | US FAERS | |
| 103 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 104 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 105 | Quadriplegia | FAERS: 1 | US FAERS | |
| 106 | Radiculopathy | FAERS: 1 | US FAERS | |
| 107 | Respiratory distress | FAERS: 1 | US FAERS | |
| 108 | Respiratory papilloma | FAERS: 1 | US FAERS | |
| 109 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 110 | Rhinitis | FAERS: 1 | US FAERS | |
| 111 | Secretion discharge | FAERS: 1 | US FAERS | |
| 112 | Sepsis | FAERS: 1 | US FAERS | |
| 113 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 114 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 115 | Sinusitis | FAERS: 1 | US FAERS | |
| 116 | Somnolence | FAERS: 1 | US FAERS | |
| 117 | Stress | FAERS: 1 | US FAERS | |
| 118 | Throat cancer | FAERS: 1 | US FAERS | |
| 119 | Throat irritation | FAERS: 1 | US FAERS | |
| 120 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 121 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 122 | Transaminases increased | FAERS: 1 | US FAERS | |
| 123 | Tremor | FAERS: 1 | US FAERS | |
| 124 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 125 | Upper respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 126 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 127 | Vasculitis | FAERS: 1 | US FAERS | |
| 128 | Aneurysm | Canada Vigilance: 1 | Canada Vigilance | |
| 129 | Dysgeusia | Canada Vigilance: 1 | Canada Vigilance | |
| 130 | Inappropriate schedule of product administration | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.