Atovaquone and proguanil hydrochloride
(IOTAOYHKWICOBK-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1ccc(cc1)C1CCC(CC1)C1=C(O)c2c(C(=O)C1=O)cccc2.CC(N=C(/N=C(/Nc1ccc(cc1)Cl)\N)N)C.Cl
- Molecular Formula:
- C33H36Cl3N5O3
- Molecular Weight:
- 657.030
- Log P:
- 9.4138
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 5
- TPSA:
- 143.16
- CAS Number(s):
- 156879-69-5
Synonym(s)
1.
Atovaquone and proguanil hydrochloride
2.
(1Z)-1-[Amino-(4-chloroanilino)methylidene]-2-propan-2-ylguanidine;3-[4-(4-chlorophenyl)cyclohexyl]-4-hydroxynaphthalene-1,2-dione;hydrochloride
3.
Atovaquone/proguanil
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Asthenia | FAERS: 2 | US FAERS | |
| 2 | Dizziness | FAERS: 2 | US FAERS | |
| 3 | Vomiting | FAERS: 2 | US FAERS | |
| 4 | Abasia | FAERS: 1 | US FAERS | |
| 5 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 6 | Arthralgia | FAERS: 1 | US FAERS | |
| 7 | Cold sweat | FAERS: 1 | US FAERS | |
| 8 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 9 | Drug ineffective | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Headache | FAERS: 1 | US FAERS | |
| 11 | Joint swelling | FAERS: 1 | US FAERS | |
| 12 | Malaria | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 13 | Meniscus injury | FAERS: 1 | US FAERS | |
| 14 | Mental status changes | FAERS: 1 | US FAERS | |
| 15 | Myalgia | FAERS: 1 | US FAERS | |
| 16 | Nausea | FAERS: 1 | US FAERS | |
| 17 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 18 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 19 | Skin reaction | FAERS: 1 | US FAERS | |
| 20 | Poor quality product administered | Canada Vigilance: 1 | Canada Vigilance | |
| 21 | Product quality issue | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120241
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.