Epinephrine and lidocaine
(HYKGUEIYMKVUSR-NPULLEENSA-N)
Structure
- SMILES
- CCN(CC(=O)Nc1c(C)cccc1C)CC.CNC[C@@H](c1ccc(c(c1)O)O)O
- Molecular Formula:
- C23H35N3O4
- Molecular Weight:
- 417.542
- Log P:
- 3.3982
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 5
- TPSA:
- 105.06
- CAS Number(s):
- 54958-67-7
Synonym(s)
1.
Epinephrine and lidocaine
External Link(s)
| PubChem Compound | 171393 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 2 | Drug ineffective | FAERS: 3 | US FAERS | |
| 3 | Product quality issue | FAERS: 3 | US FAERS | |
| 4 | Hypotension | FAERS: 2 | US FAERS | |
| 5 | Post procedural complication | FAERS: 2 | US FAERS | |
| 6 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 7 | Blindness | FAERS: 1 | US FAERS | |
| 8 | Bradycardia | FAERS: 1 | US FAERS | |
| 9 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 10 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 11 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 12 | Malaise | FAERS: 1 | US FAERS | |
| 13 | Medication Error | FAERS: 1 | US FAERS | |
| 14 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 15 | Palpitations | FAERS: 1 | US FAERS | |
| 16 | Presyncope | FAERS: 1 | US FAERS | |
| 17 | Procedural complication | FAERS: 1 | US FAERS | |
| 18 | Pupillary light reflex tests abnormal | FAERS: 1 | US FAERS | |
| 19 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 20 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 21 | Skin necrosis | FAERS: 1 | US FAERS | |
| 22 | Tremor | FAERS: 1 | US FAERS | |
| 23 | Unresponsive to stimuli | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.