Ioflupane I-123
(HXWLAJVUJSVENX-HFIFKADTSA-N)
Structure
- SMILES
- FCCCN1[C@H]2CC[C@@H]1[C@H]([C@H](C2)c1ccc(cc1)[123I])C(=O)OC
- Type(s)
- Approved
- ATC code(s)
- V09AB03
- Molecular Formula:
- C18H23FINO2
- Molecular Weight:
- 427.285
- Log P:
- 3.6982
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 0
- TPSA:
- 29.54
- CAS Number(s):
- 155798-07-5
Synonym(s)
1.
Ioflupane I-123
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | No adverse event | FAERS: 49 | US FAERS | |
| 2 | Injection site pain | FAERS: 35 | US FAERS | |
| 3 | Burning sensation | FAERS: 17 | US FAERS | |
| 4 | Drug ineffective | FAERS: 11 | US FAERS | |
| 5 | Pain | FAERS: 7 | US FAERS | |
| 6 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 7 | False negative investigation result | FAERS: 4 | US FAERS | |
| 8 | Feeling Cold | FAERS: 4 | US FAERS | |
| 9 | Oropharyngeal pain | FAERS: 4 | US FAERS | |
| 10 | Nausea | FAERS: 3 | US FAERS | |
| 11 | Vomiting | FAERS: 3 | US FAERS | |
| 12 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 13 | Anxiety | FAERS: 1 | US FAERS | |
| 14 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 15 | Chest discomfort | FAERS: 1 | US FAERS | |
| 16 | Chills | FAERS: 1 | US FAERS | |
| 17 | Dementia | FAERS: 1 | US FAERS | |
| 18 | Dizziness | FAERS: 1 | US FAERS | |
| 19 | Drug administration error | FAERS: 1 | US FAERS | |
| 20 | Dysgeusia | FAERS: 1 | US FAERS | |
| 21 | Erythema | FAERS: 1 | US FAERS | |
| 22 | False positive investigation result | FAERS: 1 | US FAERS | |
| 23 | Fatigue | FAERS: 1 | US FAERS | |
| 24 | Hypotension | FAERS: 1 | US FAERS | |
| 25 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 26 | Iodine uptake increased | FAERS: 1 | US FAERS | |
| 27 | Therapeutic response unexpected | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120238
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.