talazoparib
(HWGQMRYQVZSGDQ-HZPDHXFCSA-N)
Structure
- SMILES
- Fc1ccc(cc1)[C@H]1Nc2cc(F)cc3c2c([C@@H]1c1ncnn1C)n[nH]c3=O
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XX60
- Molecular Formula:
- C19H14F2N6O
- Molecular Weight:
- 380.351
- Log P:
- 2.7665
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 88.49
- CAS Number(s):
- 1207456-01-6
Synonym(s)
1.
talazoparib
2.
BMN 673
3.
BMN-673
4.
BMN673
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 5 | US FAERS | |
| 2 | Fatigue | FAERS: 4 | US FAERS | |
| 3 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 4 | Alopecia | FAERS: 2 | US FAERS | |
| 5 | Full blood count decreased | FAERS: 2 | US FAERS | |
| 6 | Neutropenia | FAERS: 2 | US FAERS | |
| 7 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 8 | Vomiting | FAERS: 2 | US FAERS | |
| 9 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 10 | Cytopenia | FAERS: 1 | US FAERS | |
| 11 | Dehydration | FAERS: 1 | US FAERS | |
| 12 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 13 | Gene Mutation | FAERS: 1 | US FAERS | |
| 14 | Headache | FAERS: 1 | US FAERS | |
| 15 | Leukopenia | FAERS: 1 | US FAERS | |
| 16 | Liver function test decreased | FAERS: 1 | US FAERS | |
| 17 | Malaise | FAERS: 1 | US FAERS | |
| 18 | Mydriasis | FAERS: 1 | US FAERS | |
| 19 | Product use issue | FAERS: 1 | US FAERS | |
| 20 | Radiation injury | FAERS: 1 | US FAERS | |
| 21 | Therapy cessation | FAERS: 1 | US FAERS | |
| 22 | Visual Impairment | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120262
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.