Levoflaxacin
(HSVIINWFPKEOEQ-NSHDSACASA-N)
Structure
- SMILES
- COC(=O)c1cn2[C@@H](C)COc3c2c(c1=O)cc(c3N1CCN(CC1)C)F
- Molecular Formula:
- C19H22FN3O4
- Molecular Weight:
- 375.394
- Log P:
- 1.6353
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 0
- TPSA:
- 64.01
- CAS Number(s):
- 862690-19-5
Synonym(s)
1.
Levoflaxacin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pain | FAERS: 2 | US FAERS | |
| 2 | Acute psychosis | FAERS: 1 | US FAERS | |
| 3 | Angioedema | FAERS: 1 | US FAERS | |
| 4 | Anxiety | FAERS: 1 | US FAERS | |
| 5 | Burning sensation | FAERS: 1 | US FAERS | |
| 6 | Choking | FAERS: 1 | US FAERS | |
| 7 | Discomfort | FAERS: 1 | US FAERS | |
| 8 | Fatigue | FAERS: 1 | US FAERS | |
| 9 | Gait inability | FAERS: 1 | US FAERS | |
| 10 | Hypotension | FAERS: 1 | US FAERS | |
| 11 | Lip swelling | FAERS: 1 | US FAERS | |
| 12 | Malaise | FAERS: 1 | US FAERS | |
| 13 | Memory impairment | FAERS: 1 | US FAERS | |
| 14 | Mood swings | FAERS: 1 | US FAERS | |
| 15 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 16 | Neuralgia | FAERS: 1 | US FAERS | |
| 17 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 18 | Postural Orthostatic Tachycardia Syndrome | FAERS: 1 | US FAERS | |
| 19 | Product quality issue | FAERS: 1 | US FAERS | |
| 20 | Pruritus | FAERS: 1 | US FAERS | |
| 21 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 22 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 23 | Urticaria | FAERS: 1 | US FAERS | |
| 24 | Weight decreased | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120269
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.