Atropine
(HOBWAPHTEJGALG-JKCMADFCSA-N)
Structure
- SMILES
- OS(=O)(=O)O.OCC(c1ccccc1)C(=O)OC1C[C@@H]2CC[C@H](C1)N2C.OCC(c1ccccc1)C(=O)OC1C[C@@H]2CC[C@H](C1)N2C
- Molecular Formula:
- C34H48N2O10S
- Molecular Weight:
- 676.817
- Log P:
- 4.1656
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 4
- TPSA:
- 182.52
- CAS Number(s):
- 55-48-1
Synonym(s)
1.
Atropine
2.
AtroPen
3.
Atropin Augenöl
4.
Atropine Sulfate
5.
Atropine Sulfate Anhydrous
6.
Atropinol
7.
Anhydrous, Atropine Sulfate
8.
Augenöl, Atropin
9.
Sulfate Anhydrous, Atropine
10.
Sulfate, Atropine
External Link(s)
| MeSH | D001285 |
| PubChem Compound | 18530349 60196398 |
| CHEMBL | CHEMBL3185794 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Toxicity to various agents | FAERS: 12 | US FAERS | |
| 2 | Mydriasis | FAERS: 10 | US FAERS | |
| 3 | Agitation | FAERS: 8 | US FAERS | |
| 4 | Tachycardia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Anticholinergic Syndrome | FAERS: 6 | US FAERS | |
| 6 | Medication Error | FAERS: 6 | US FAERS | |
| 7 | Bradycardia | FAERS: 5 | US FAERS | |
| 8 | Delirium | FAERS: 5 | US FAERS | |
| 9 | Incorrect route of drug administration | FAERS: 5 | US FAERS | |
| 10 | Pharmaceutical product complaint | FAERS: 5 | US FAERS | |
| 11 | Drug ineffective | FAERS: 4 | US FAERS | |
| 12 | Flushing | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Malaise | FAERS: 4 | US FAERS | |
| 14 | Overdose | FAERS: 4 | US FAERS | |
| 15 | Urinary Retention | FAERS: 4 | US FAERS | |
| 16 | Visual Impairment | FAERS: 4 | US FAERS | |
| 17 | Accidental overdose | FAERS: 3 | US FAERS | |
| 18 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 19 | Device Failure | FAERS: 3 | US FAERS | |
| 20 | Device breakage | FAERS: 3 | US FAERS | |
| 21 | Dysarthria | FAERS: 3 | US FAERS | |
| 22 | Erythema | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Eye pain | FAERS: 3 | US FAERS | |
| 24 | Hypotension | FAERS: 3 | US FAERS | |
| 25 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 26 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 27 | Bronchospasm | FAERS: 2 | US FAERS | |
| 28 | Chest Pain | FAERS: 2 | US FAERS | |
| 29 | Hyperpyrexia | FAERS: 2 | US FAERS | |
| 30 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 31 | Mental status changes | FAERS: 2 | US FAERS | |
| 32 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 33 | Nausea | FAERS: 2 | US FAERS | |
| 34 | No adverse event | FAERS: 2 | US FAERS | |
| 35 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 36 | Restlessness | FAERS: 2 | US FAERS | |
| 37 | Syncope | FAERS: 2 | US FAERS | |
| 38 | Tremor | FAERS: 2 | US FAERS | |
| 39 | Unevaluable event | FAERS: 2 | US FAERS | |
| 40 | Ventricular hypokinesia | FAERS: 2 | US FAERS | |
| 41 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 42 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 43 | Accidental exposure | FAERS: 1 | US FAERS | |
| 44 | Administration related reaction | FAERS: 1 | US FAERS | |
| 45 | Aphasia | FAERS: 1 | US FAERS | |
| 46 | Asthenia | FAERS: 1 | US FAERS | |
| 47 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 48 | Bedridden | FAERS: 1 | US FAERS | |
| 49 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 50 | Burning sensation | FAERS: 1 | US FAERS | |
| 51 | Choroidal Detachment | FAERS: 1 | US FAERS | |
| 52 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 53 | Complication of device insertion | FAERS: 1 | US FAERS | |
| 54 | Dizziness | FAERS: 1 | US FAERS | |
| 55 | Drug administration error | FAERS: 1 | US FAERS | |
| 56 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 57 | Dry skin | FAERS: 1 | US FAERS | |
| 58 | Dysgeusia | FAERS: 1 | US FAERS | |
| 59 | Dysuria | FAERS: 1 | US FAERS | |
| 60 | Exposure via inhalation | FAERS: 1 | US FAERS | |
| 61 | Eye irritation | FAERS: 1 | US FAERS | |
| 62 | Headache | FAERS: 1 | US FAERS | |
| 63 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 64 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 65 | Limb injury | FAERS: 1 | US FAERS | |
| 66 | Maternal exposure during delivery | FAERS: 1 | US FAERS | |
| 67 | Medical device complication | FAERS: 1 | US FAERS | |
| 68 | Meningism | FAERS: 1 | US FAERS | |
| 69 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 70 | Photophobia | FAERS: 1 | US FAERS | |
| 71 | Post procedural complication | FAERS: 1 | US FAERS | |
| 72 | Product dropper issue | FAERS: 1 | US FAERS | |
| 73 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 74 | Product lot number issue | FAERS: 1 | US FAERS | |
| 75 | Product use issue | FAERS: 1 | US FAERS | |
| 76 | Rales | FAERS: 1 | US FAERS | |
| 77 | Rash erythematous | FAERS: 1 | US FAERS | |
| 78 | Skeletal injury | FAERS: 1 | US FAERS | |
| 79 | Somnolence | FAERS: 1 | US FAERS | |
| 80 | Staring | FAERS: 1 | US FAERS | |
| 81 | Stertor | FAERS: 1 | US FAERS | |
| 82 | Strabismus | FAERS: 1 | US FAERS | |
| 83 | Suicide attempt | FAERS: 1 | US FAERS | |
| 84 | Troponin increased | FAERS: 1 | US FAERS | |
| 85 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 86 | Vomiting | FAERS: 1 | US FAERS | |
| 87 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 88 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 89 | nervous system disorder | FAERS: 1 | US FAERS | |
| 90 | prostatitis | FAERS: 1 | US FAERS | |
| 91 | Atrial tachycardia | Canada Vigilance: 1 | Canada Vigilance | |
| 92 | Device malfunction | Canada Vigilance: 1 | Canada Vigilance | |
| 93 | Extra dose administered | Canada Vigilance: 1 | Canada Vigilance | |
| 94 | Product use in unapproved indication | Canada Vigilance: 1 | Canada Vigilance | |
| 95 | Syringe issue | Canada Vigilance: 1 | Canada Vigilance | |
| 96 | Therapy cessation | Canada Vigilance: 1 | Canada Vigilance | |
| 97 | treatment failure | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.