Fluticasone propionate mixture with Salmeterol xinafoate
(HGAWNGJWULGUPZ-YGACESMGSA-N)
Structure
- SMILES
- OC(=O)c1ccc2c(c1O)cccc2.OCc1cc(ccc1O)C(CNCCCCCCOCCCCc1ccccc1)O.FCSC(=O)[C@@]1(OC(=O)CC)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)C1([C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)F)F
- Molecular Formula:
- C61H76F3NO12S
- Molecular Weight:
- 1104.320
- Log P:
- 11.1719
- Hydrogen Bond Acceptor:
- 14
- Hydrogen Bond Donor:
- 7
- TPSA:
- 245.45
- CAS Number(s):
- 136112-02-2
Synonym(s)
1.
Fluticasone propionate mixture with Salmeterol xinafoate
External Link(s)
| PubChem Compound | 71300723 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Asthma | FAERS: 78 | US FAERS | |
| 2 | Product quality issue | FAERS: 61 | US FAERS | |
| 3 | Drug ineffective | FAERS: 30 | US FAERS | |
| 4 | Overdose | FAERS: 11 | US FAERS | |
| 5 | Dysphonia | FAERS: 10 | US FAERS | |
| 6 | Oral candidiasis | FAERS: 6 | US FAERS | |
| 7 | Pulmonary Fibrosis | FAERS: 6 | US FAERS | |
| 8 | Choking | FAERS: 5 | US FAERS | |
| 9 | Conjunctivitis | FAERS: 5 | US FAERS | |
| 10 | Tremor | FAERS: 5 | US FAERS | |
| 11 | Wheezing | FAERS: 5 | US FAERS | |
| 12 | Burning sensation | FAERS: 4 | US FAERS | |
| 13 | Palpitations | FAERS: 4 | US FAERS | |
| 14 | Bronchospasm | FAERS: 3 | US FAERS | |
| 15 | Dizziness | FAERS: 3 | US FAERS | |
| 16 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 17 | Headache | FAERS: 3 | US FAERS | |
| 18 | Pneumonia | FAERS: 3 | US FAERS | |
| 19 | Rhinitis | FAERS: 3 | US FAERS | |
| 20 | Stomatitis | FAERS: 3 | US FAERS | |
| 21 | Syncope | FAERS: 3 | US FAERS | |
| 22 | Throat irritation | FAERS: 3 | US FAERS | |
| 23 | Back Pain | FAERS: 2 | US FAERS | |
| 24 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 25 | Bronchopulmonary Aspergillosis | FAERS: 2 | US FAERS | |
| 26 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 27 | Chest Pain | FAERS: 2 | US FAERS | |
| 28 | Chest discomfort | FAERS: 2 | US FAERS | |
| 29 | Device malfunction | FAERS: 2 | US FAERS | |
| 30 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 31 | Drug administration error | FAERS: 2 | US FAERS | |
| 32 | Dysgeusia | FAERS: 2 | US FAERS | |
| 33 | Eye pain | FAERS: 2 | US FAERS | |
| 34 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 35 | Malaise | FAERS: 2 | US FAERS | |
| 36 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 37 | Nausea | FAERS: 2 | US FAERS | |
| 38 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 39 | Product counterfeit | FAERS: 2 | US FAERS | |
| 40 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 41 | Productive Cough | FAERS: 2 | US FAERS | |
| 42 | Pruritus | FAERS: 2 | US FAERS | |
| 43 | Sepsis | FAERS: 2 | US FAERS | |
| 44 | Tachycardia | FAERS: 2 | US FAERS | |
| 45 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 46 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 47 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 48 | Alopecia | FAERS: 1 | US FAERS | |
| 49 | Amnesia | FAERS: 1 | US FAERS | |
| 50 | Anger | FAERS: 1 | US FAERS | |
| 51 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 52 | Arthralgia | FAERS: 1 | US FAERS | |
| 53 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 54 | Aspergillosis | FAERS: 1 | US FAERS | |
| 55 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 56 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 57 | Blood Corticotrophin Decreased | FAERS: 1 | US FAERS | |
| 58 | Bone pain | FAERS: 1 | US FAERS | |
| 59 | Bronchitis | FAERS: 1 | US FAERS | |
| 60 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 61 | Candidiasis | FAERS: 1 | US FAERS | |
| 62 | Compression fracture | FAERS: 1 | US FAERS | |
| 63 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 64 | Device Failure | FAERS: 1 | US FAERS | |
| 65 | Device ineffective | FAERS: 1 | US FAERS | |
| 66 | Disability | FAERS: 1 | US FAERS | |
| 67 | Discomfort | FAERS: 1 | US FAERS | |
| 68 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 69 | Epilepsy | FAERS: 1 | US FAERS | |
| 70 | Erythema | FAERS: 1 | US FAERS | |
| 71 | Expired drug administered | FAERS: 1 | US FAERS | |
| 72 | Exposure via semen | FAERS: 1 | US FAERS | |
| 73 | Flatulence | FAERS: 1 | US FAERS | |
| 74 | Fracture pain | FAERS: 1 | US FAERS | |
| 75 | Gastritis | FAERS: 1 | US FAERS | |
| 76 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 77 | Hypotension | FAERS: 1 | US FAERS | |
| 78 | Infarction | FAERS: 1 | US FAERS | |
| 79 | Initial insomnia | FAERS: 1 | US FAERS | |
| 80 | Leukocytosis | FAERS: 1 | US FAERS | |
| 81 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 82 | Mouth Breathing | FAERS: 1 | US FAERS | |
| 83 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 84 | No adverse event | FAERS: 1 | US FAERS | |
| 85 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 86 | Oropharyngeal candidiasis | FAERS: 1 | US FAERS | |
| 87 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 88 | Oxygen consumption increased | FAERS: 1 | US FAERS | |
| 89 | Pneumonitis | FAERS: 1 | US FAERS | |
| 90 | Renal pain | FAERS: 1 | US FAERS | |
| 91 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 92 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 93 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 94 | Saliva altered | FAERS: 1 | US FAERS | |
| 95 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 96 | Sudden death | FAERS: 1 | US FAERS | |
| 97 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 98 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 99 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 100 | Upper respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 101 | Urticaria | FAERS: 1 | US FAERS | |
| 102 | Visual Impairment | FAERS: 1 | US FAERS | |
| 103 | Vocal Cord Paralysis | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.