Diclofenac Sodium and Misoprostol
(HDEFOQFNRFJUCB-ZJJFNMROSA-M)
Structure
- SMILES
- [O-]C(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl.CCCCC(C/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)OC)(O)C.[Na+]
- Molecular Formula:
- C36H48Cl2NNaO7
- Molecular Weight:
- 700.665
- Log P:
- 7.0560
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 3
- TPSA:
- 135.99
- CAS Number(s):
- 239810-53-8
Synonym(s)
1.
Diclofenac Sodium and Misoprostol
External Link(s)
| PubChem Compound | 23690066 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Injection site injury | FAERS: 2 | US FAERS | |
| 2 | Neonatal respiratory acidosis | FAERS: 2 | US FAERS | |
| 3 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 4 | Sciatic Nerve Palsy | FAERS: 2 | US FAERS | |
| 5 | Amniotic Band Syndrome | FAERS: 1 | US FAERS | |
| 6 | Ascites | FAERS: 1 | US FAERS | |
| 7 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 8 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 9 | Congenital pulmonary hypertension | FAERS: 1 | US FAERS | |
| 10 | Drug ineffective | FAERS: 1 | US FAERS | |
| 11 | Dysphonia | FAERS: 1 | US FAERS | |
| 12 | Kounis Syndrome | FAERS: 1 | US FAERS | |
| 13 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 14 | Product substitution issue | FAERS: 1 | US FAERS | |
| 15 | Rash erythematous | FAERS: 1 | US FAERS | |
| 16 | Sepsis | FAERS: 1 | US FAERS | |
| 17 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.