Rivastigmine
(GWHQHAUAXRMMOT-MBANBULQSA-N)
Structure
- SMILES
- O[C@H]([C@H](C(=O)O)O)C(=O)O.CCN(C(=O)Oc1cccc(c1)[C@@H](N(C)C)C)C
- Molecular Formula:
- C18H28N2O8
- Molecular Weight:
- 400.424
- Log P:
- 0.6371
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 4
- TPSA:
- 147.84
- CAS Number(s):
- 129101-54-8
Synonym(s)
1.
Rivastigmine
2.
(S)-N-Ethyl-3-((1-dimethyl-amino)ethyl)-N-methylphenylcarbamate
3.
ENA 713
4.
ENA-713
5.
Exelon
6.
Rivastigmine Hydrogen Tartrate
7.
RivastigmineTartrate
8.
SDZ ENA 713
9.
713, ENA
10.
713, SDZ ENA
11.
ENA 713, SDZ
12.
ENA713
13.
Hydrogen Tartrate, Rivastigmine
14.
Tartrate, Rivastigmine Hydrogen
External Link(s)
| MeSH | D000068836 |
| PubChem Compound | 6918078 |
| ChEBI | 64358 |
| KEGG | dr:D02558 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Wrong technique in product usage process | FAERS: 16 | US FAERS | |
| 2 | Pneumonia | FAERS: 10 | US FAERS | |
| 3 | Fracture | FAERS: 9 | US FAERS | |
| 4 | Dementia | FAERS: 8 | US FAERS | |
| 5 | Vomiting | FAERS: 8 | US FAERS | |
| 6 | Drug prescribing error | FAERS: 6 | US FAERS | |
| 7 | Nausea | FAERS: 6 | US FAERS | |
| 8 | Depressed Level of Consciousness | FAERS: 5 | US FAERS | |
| 9 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 10 | Overdose | FAERS: 5 | US FAERS | |
| 11 | Restlessness | FAERS: 4 | US FAERS | |
| 12 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 13 | Agitation | FAERS: 3 | US FAERS | |
| 14 | Anticholinergic Syndrome | FAERS: 3 | US FAERS | |
| 15 | Apathy | FAERS: 3 | US FAERS | |
| 16 | Application site pruritus | FAERS: 3 | US FAERS | |
| 17 | Asthenia | FAERS: 3 | US FAERS | |
| 18 | Blood cholinesterase decreased | FAERS: 3 | US FAERS | |
| 19 | Bradycardia | FAERS: 3 | US FAERS | |
| 20 | Delirium | FAERS: 3 | US FAERS | |
| 21 | Dizziness | FAERS: 3 | US FAERS | |
| 22 | Drug ineffective | FAERS: 3 | US FAERS | |
| 23 | Malaise | FAERS: 3 | US FAERS | |
| 24 | Sepsis | FAERS: 3 | US FAERS | |
| 25 | Somnolence | FAERS: 3 | US FAERS | |
| 26 | Tuberculosis | FAERS: 3 | US FAERS | |
| 27 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 28 | Amaurosis Fugax | FAERS: 2 | US FAERS | |
| 29 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 30 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 31 | Dehydration | FAERS: 2 | US FAERS | |
| 32 | Dermatitis | FAERS: 2 | US FAERS | |
| 33 | Hypophagia | FAERS: 2 | US FAERS | |
| 34 | Infection | FAERS: 2 | US FAERS | |
| 35 | No adverse event | FAERS: 2 | US FAERS | |
| 36 | Product quality issue | FAERS: 2 | US FAERS | |
| 37 | Pruritus | FAERS: 2 | US FAERS | |
| 38 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 39 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 40 | Tremor | FAERS: 2 | US FAERS | |
| 41 | Urinary Retention | FAERS: 2 | US FAERS | |
| 42 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 43 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 44 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 45 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 46 | Akinesia | FAERS: 1 | US FAERS | |
| 47 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 48 | Application site erythema | FAERS: 1 | US FAERS | |
| 49 | Application site reaction | FAERS: 1 | US FAERS | |
| 50 | Application site vesicles | FAERS: 1 | US FAERS | |
| 51 | Arthropathy | FAERS: 1 | US FAERS | |
| 52 | Back Pain | FAERS: 1 | US FAERS | |
| 53 | Brain Contusion | FAERS: 1 | US FAERS | |
| 54 | Cellulitis | FAERS: 1 | US FAERS | |
| 55 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 56 | Compression fracture | FAERS: 1 | US FAERS | |
| 57 | Cytopenia | FAERS: 1 | US FAERS | |
| 58 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 59 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 60 | Disorientation | FAERS: 1 | US FAERS | |
| 61 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 62 | Drug toxicity | FAERS: 1 | US FAERS | |
| 63 | Dysuria | FAERS: 1 | US FAERS | |
| 64 | Erythema | FAERS: 1 | US FAERS | |
| 65 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 66 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 67 | Freezing phenomenon | FAERS: 1 | US FAERS | |
| 68 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 69 | Glaucoma | FAERS: 1 | US FAERS | |
| 70 | Headache | FAERS: 1 | US FAERS | |
| 71 | Hyperventilation | FAERS: 1 | US FAERS | |
| 72 | Ileus | FAERS: 1 | US FAERS | |
| 73 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 74 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 75 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 76 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 77 | Large intestinal polypectomy | FAERS: 1 | US FAERS | |
| 78 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 79 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 80 | Myalgia | FAERS: 1 | US FAERS | |
| 81 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 82 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 83 | Necrosis | FAERS: 1 | US FAERS | |
| 84 | Osteoporosis | FAERS: 1 | US FAERS | |
| 85 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 86 | Pancreatitis | FAERS: 1 | US FAERS | |
| 87 | Pleurothotonus | FAERS: 1 | US FAERS | |
| 88 | Product commingling | FAERS: 1 | US FAERS | |
| 89 | Product complaint | FAERS: 1 | US FAERS | |
| 90 | Product dose omission | FAERS: 1 | US FAERS | |
| 91 | Product substitution issue | FAERS: 1 | US FAERS | |
| 92 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 93 | Respiratory distress | FAERS: 1 | US FAERS | |
| 94 | Sclerema | FAERS: 1 | US FAERS | |
| 95 | Sense of oppression | FAERS: 1 | US FAERS | |
| 96 | Septic Shock | FAERS: 1 | US FAERS | |
| 97 | Syncope | FAERS: 1 | US FAERS | |
| 98 | Tongue movement disturbance | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.