2-[4,7-Bis(carboxylatomethyl)-10-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+)
(GFSTXYOTEVLASN-UHFFFAOYSA-K)
Structure
- SMILES
- [O-]C(=O)CN1CCN(CCN(CCN(CC1)CC(=O)[O-])CC(=O)O)CC(=O)[O-].[Gd+3]
- Type(s)
- Approved
- ATC code(s)
- V08CA02
- Molecular Formula:
- C16H25GdN4O8
- Molecular Weight:
- 558.642
- Log P:
- -6.7061
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 1
- TPSA:
- 170.65
- CAS Number(s):
- 72573-82-1; 83678-67-5
Synonym(s)
1.
2-[4,7-Bis(carboxylatomethyl)-10-(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+)
2.
Gadoteric acid
3.
Gd-Dota
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Erythema | FAERS: 2 | US FAERS | |
| 2 | Injection site erythema | FAERS: 2 | US FAERS | |
| 3 | Injection site extravasation | FAERS: 2 | US FAERS | |
| 4 | Injection site pain | FAERS: 2 | US FAERS | |
| 5 | Throat irritation | FAERS: 2 | US FAERS | |
| 6 | Apathy | FAERS: 1 | US FAERS | |
| 7 | Asthma | FAERS: 1 | US FAERS | |
| 8 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 9 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 10 | Contrast media allergy | FAERS: 1 | US FAERS | |
| 11 | Contrast media reaction | FAERS: 1 | US FAERS | |
| 12 | Dysgeusia | FAERS: 1 | US FAERS | |
| 13 | Eczema | FAERS: 1 | US FAERS | |
| 14 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 15 | Hypotension | FAERS: 1 | US FAERS | |
| 16 | Injected limb mobility decreased | FAERS: 1 | US FAERS | |
| 17 | Laryngeal discomfort | FAERS: 1 | US FAERS | |
| 18 | Larynx irritation | FAERS: 1 | US FAERS | |
| 19 | Nausea | FAERS: 1 | US FAERS | |
| 20 | Neuritis | FAERS: 1 | US FAERS | |
| 21 | Sense of oppression | FAERS: 1 | US FAERS | |
| 22 | Syncope | FAERS: 1 | US FAERS | |
| 23 | Tachycardia | FAERS: 1 | US FAERS | |
| 24 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 25 | Urticaria | FAERS: 1 | US FAERS | |
| 26 | Vertigo | FAERS: 1 | US FAERS | |
| 27 | Vomiting | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.