Citalopram hydrochloride
(FXSXPIKCGLXHAW-UHFFFAOYSA-N)
Structure
- SMILES
- N#Cc1ccc2c(c1)COC2(CCCN(C)C)c1ccc(cc1)F.Cl
- Molecular Formula:
- C20H22ClFN2O
- Molecular Weight:
- 360.853
- Log P:
- 4.6150
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 36.26
- CAS Number(s):
- 85118-27-0
Synonym(s)
1.
Citalopram hydrochloride
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 2 | Completed Suicide | FAERS: 1 | US FAERS | |
| 3 | Drug abuse | FAERS: 1 | US FAERS | |
| 4 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 5 | Headache | FAERS: 1 | US FAERS | |
| 6 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 7 | Malaise | FAERS: 1 | US FAERS | |
| 8 | Mydriasis | FAERS: 1 | US FAERS | |
| 9 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 10 | Premature Ejaculation | FAERS: 1 | US FAERS | |
| 11 | Sopor | FAERS: 1 | US FAERS | |
| 12 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 13 | Tremor | FAERS: 1 | US FAERS | |
| 14 | Vomiting | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.