Sodium Tetradecyl Sulfate
(FVEFRICMTUKAML-UHFFFAOYSA-M)
Structure
- SMILES
- CCCCC(CCC(OS(=O)(=O)[O-])CC(C)C)CC.[Na+]
- Type(s)
- Approved; Investigational
- ATC code(s)
- C05BB04
- Molecular Formula:
- C14H29NaO4S
- Molecular Weight:
- 316.432
- Log P:
- 4.9553
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 0
- TPSA:
- 74.81
- CAS Number(s):
- 139-88-8
Synonym(s)
1.
Sodium Tetradecyl Sulfate
2.
Sotradecol
3.
Sotradecol Sodium
4.
Tergitol 4
5.
Trombavar
6.
Trombovar
7.
Sulfate, Sodium Tetradecyl
8.
Tetradecyl Sulfate, Sodium
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Erythema | FAERS: 5 | US FAERS | |
| 2 | Ulcer | FAERS: 5 | US FAERS | |
| 3 | Eschar | FAERS: 4 | US FAERS | |
| 4 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 5 | Formication | FAERS: 3 | US FAERS | |
| 6 | Injection site pain | FAERS: 3 | US FAERS | |
| 7 | Myalgia | FAERS: 3 | US FAERS | |
| 8 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 9 | Accidental exposure | FAERS: 2 | US FAERS | |
| 10 | Exposure during breast feeding | FAERS: 2 | US FAERS | |
| 11 | Inflammation | FAERS: 2 | US FAERS | |
| 12 | Injection site erythema | FAERS: 2 | US FAERS | |
| 13 | Injection site ulcer | FAERS: 2 | US FAERS | |
| 14 | Necrosis | FAERS: 2 | US FAERS | |
| 15 | Post procedural complication | FAERS: 2 | US FAERS | |
| 16 | Presyncope | FAERS: 2 | US FAERS | |
| 17 | Procedural complication | FAERS: 2 | US FAERS | |
| 18 | Product quality issue | FAERS: 2 | US FAERS | |
| 19 | Product substitution issue | FAERS: 2 | US FAERS | |
| 20 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 21 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 22 | Acidosis | FAERS: 1 | US FAERS | |
| 23 | Air Embolism | FAERS: 1 | US FAERS | |
| 24 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 25 | Aphasia | FAERS: 1 | US FAERS | |
| 26 | Blindness | FAERS: 1 | US FAERS | |
| 27 | Burning sensation | FAERS: 1 | US FAERS | |
| 28 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 29 | Cellulitis | FAERS: 1 | US FAERS | |
| 30 | Ear discomfort | FAERS: 1 | US FAERS | |
| 31 | Eye irritation | FAERS: 1 | US FAERS | |
| 32 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 33 | Hemiparesis | FAERS: 1 | US FAERS | |
| 34 | Hypotension | FAERS: 1 | US FAERS | |
| 35 | Infection | FAERS: 1 | US FAERS | |
| 36 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 37 | Injection site irritation | FAERS: 1 | US FAERS | |
| 38 | Joint swelling | FAERS: 1 | US FAERS | |
| 39 | NIH stroke scale score increased | FAERS: 1 | US FAERS | |
| 40 | Nausea | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Nephritis allergic | FAERS: 1 | US FAERS | |
| 42 | No adverse event | FAERS: 1 | US FAERS | |
| 43 | Overdose | FAERS: 1 | US FAERS | |
| 44 | Pain | FAERS: 1 | US FAERS | |
| 45 | Physical product label issue | FAERS: 1 | US FAERS | |
| 46 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 47 | Retinal artery embolism | FAERS: 1 | US FAERS | |
| 48 | Scab | FAERS: 1 | US FAERS | |
| 49 | Shock | FAERS: 1 | US FAERS | |
| 50 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 51 | Skin necrosis | FAERS: 1 | US FAERS | |
| 52 | Swelling | FAERS: 1 | US FAERS | |
| 53 | Tinnitus | FAERS: 1 | US FAERS | |
| 54 | Tremor | FAERS: 1 | US FAERS | |
| 55 | Vasculitis | FAERS: 1 | US FAERS | |
| 56 | Visual Impairment | FAERS: 1 | US FAERS | |
| 57 | Visual brightness | FAERS: 1 | US FAERS | |
| 58 | Wheezing | FAERS: 1 | US FAERS | |
| 59 | Abdominal discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 60 | Dizziness | Canada Vigilance: 2 | Canada Vigilance | |
| 61 | Flushing | Canada Vigilance: 1 | Canada Vigilance | |
| 62 | Tachycardia | Canada Vigilance: 1 | Canada Vigilance | |
| 63 | Urticaria | Canada Vigilance: 3 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.