eliglustat
(FJZZPCZKBUKGGU-AUSIDOKSSA-N)
Structure
- SMILES
- CCCCCCCC(=O)N[C@@H]([C@@H](c1ccc2c(c1)OCCO2)O)CN1CCCC1
- Type(s)
- Approved
- ATC code(s)
- A16AX10
- Molecular Formula:
- C23H36N2O4
- Molecular Weight:
- 404.543
- Log P:
- 3.7611
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 71.03
- CAS Number(s):
- 491833-29-5
Synonym(s)
1.
eliglustat
2.
Cerdelga
3.
Genz-112638
4.
eliglustat tartrate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 2 | Anxiety | FAERS: 2 | US FAERS | |
| 3 | Arthralgia | FAERS: 2 | SIDER US FAERS | |
| 4 | Ascites | FAERS: 2 | US FAERS | |
| 5 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 6 | Dyspepsia | FAERS: 2 | SIDER US FAERS | |
| 7 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 8 | Osteopenia | FAERS: 2 | US FAERS | |
| 9 | Pain | FAERS: 2 | SIDER US FAERS | |
| 10 | Protein-losing gastroenteropathy | FAERS: 2 | US FAERS | |
| 11 | Waist circumference increased | FAERS: 2 | US FAERS | |
| 12 | Abscess | FAERS: 1 | US FAERS | |
| 13 | Asthenia | FAERS: 1 | SIDER US FAERS | |
| 14 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 15 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 16 | Chest Pain | FAERS: 1 | US FAERS | |
| 17 | Dementia | FAERS: 1 | US FAERS | |
| 18 | Dental caries | FAERS: 1 | US FAERS | |
| 19 | Diverticulitis | FAERS: 1 | US FAERS | |
| 20 | Eczema | FAERS: 1 | US FAERS | |
| 21 | Erythema | FAERS: 1 | US FAERS | |
| 22 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 23 | Malaise | FAERS: 1 | US FAERS | |
| 24 | Periarthritis | FAERS: 1 | US FAERS | |
| 25 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 26 | Polydipsia | FAERS: 1 | US FAERS | |
| 27 | Polyuria | FAERS: 1 | US FAERS | |
| 28 | Product use issue | FAERS: 1 | US FAERS | |
| 29 | Psoriasis | FAERS: 1 | US FAERS | |
| 30 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 31 | Thrombosis | FAERS: 1 | US FAERS | |
| 32 | Weight decreased | FAERS: 1 | US FAERS | |
| 33 | nervous system disorder | FAERS: 1 | US FAERS | |
| 34 | Back Pain | SIDER | ||
| 35 | Constipation | SIDER | ||
| 36 | Dermatitis | SIDER | ||
| 37 | Dizziness | SIDER | ||
| 38 | Fatigue | SIDER | ||
| 39 | Flatulence | SIDER | ||
| 40 | Headache | SIDER | ||
| 41 | Musculoskeletal discomfort | SIDER | ||
| 42 | Nausea | SIDER | ||
| 43 | Oropharyngeal pain | SIDER | ||
| 44 | Palpitations | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120241
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.