Estradiol acetate
(FHXBMXJMKMWVRG-SLHNCBLASA-N)
Structure
- SMILES
- CC(=O)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C
- Type(s)
- Approved; Investigational; Vet_approved
- Molecular Formula:
- C20H26O3
- Molecular Weight:
- 314.419
- Log P:
- 3.8289
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 46.53
- CAS Number(s):
- 4245-41-4
Synonym(s)
1.
Estradiol acetate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 56 | US FAERS | |
| 2 | Drug effect incomplete | FAERS: 12 | US FAERS | |
| 3 | Headache | FAERS: 12 | US FAERS | |
| 4 | Device expulsion | FAERS: 10 | US FAERS | |
| 5 | Vulvovaginal dryness | FAERS: 9 | US FAERS | |
| 6 | Abdominal Pain | FAERS: 8 | US FAERS | |
| 7 | Drug dose omission | FAERS: 7 | US FAERS | |
| 8 | Product use in unapproved indication | FAERS: 7 | US FAERS | |
| 9 | Feeling abnormal | FAERS: 6 | US FAERS | |
| 10 | Nausea | FAERS: 6 | US FAERS | |
| 11 | Vulvovaginal discomfort | FAERS: 6 | US FAERS | |
| 12 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 13 | Alopecia | FAERS: 5 | US FAERS | |
| 14 | Device difficult to use | FAERS: 5 | US FAERS | |
| 15 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 16 | Malaise | FAERS: 5 | US FAERS | |
| 17 | Night sweats | FAERS: 5 | US FAERS | |
| 18 | Discomfort | FAERS: 4 | US FAERS | |
| 19 | Emotional disorder | FAERS: 4 | US FAERS | |
| 20 | Pain | FAERS: 4 | US FAERS | |
| 21 | Vulvovaginal mycotic infection | FAERS: 4 | US FAERS | |
| 22 | Back Pain | FAERS: 3 | US FAERS | |
| 23 | Constipation | FAERS: 3 | US FAERS | |
| 24 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 25 | Mental impairment | FAERS: 3 | US FAERS | |
| 26 | Migraine with Aura | FAERS: 3 | US FAERS | |
| 27 | Product quality issue | FAERS: 3 | US FAERS | |
| 28 | Pruritus | FAERS: 3 | US FAERS | |
| 29 | Spinal column injury | FAERS: 3 | US FAERS | |
| 30 | Vaginal Discharge | FAERS: 3 | US FAERS | |
| 31 | Vulvovaginal pain | FAERS: 3 | US FAERS | |
| 32 | Anxiety | FAERS: 2 | US FAERS | |
| 33 | Bladder prolapse | FAERS: 2 | US FAERS | |
| 34 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 35 | Device dislocation | FAERS: 2 | US FAERS | |
| 36 | Dizziness | FAERS: 2 | US FAERS | |
| 37 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 38 | Dyspareunia | FAERS: 2 | US FAERS | |
| 39 | Fatigue | FAERS: 2 | US FAERS | |
| 40 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 41 | Hyperventilation | FAERS: 2 | US FAERS | |
| 42 | Medical device complication | FAERS: 2 | US FAERS | |
| 43 | Mood swings | FAERS: 2 | US FAERS | |
| 44 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 45 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 46 | Product dose omission | FAERS: 2 | US FAERS | |
| 47 | Product physical issue | FAERS: 2 | US FAERS | |
| 48 | Therapeutic product effect decreased | FAERS: 2 | US FAERS | |
| 49 | Therapeutic product ineffective | FAERS: 2 | US FAERS | |
| 50 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 51 | Urticaria | FAERS: 2 | US FAERS | |
| 52 | Uterine Prolapse | FAERS: 2 | US FAERS | |
| 53 | Vomiting | FAERS: 2 | US FAERS | |
| 54 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 55 | Adverse event | FAERS: 1 | US FAERS | |
| 56 | Application site discomfort | FAERS: 1 | US FAERS | |
| 57 | Application site irritation | FAERS: 1 | US FAERS | |
| 58 | Asthenia | FAERS: 1 | US FAERS | |
| 59 | Atrophic vulvovaginitis | FAERS: 1 | US FAERS | |
| 60 | Blindness | FAERS: 1 | US FAERS | |
| 61 | Bone pain | FAERS: 1 | US FAERS | |
| 62 | Breast discomfort | FAERS: 1 | US FAERS | |
| 63 | Breast tenderness | FAERS: 1 | US FAERS | |
| 64 | Burning sensation | FAERS: 1 | US FAERS | |
| 65 | Chest Pain | FAERS: 1 | US FAERS | |
| 66 | Chills | FAERS: 1 | US FAERS | |
| 67 | Chloasma | FAERS: 1 | US FAERS | |
| 68 | Cholecystitis | FAERS: 1 | US FAERS | |
| 69 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 70 | Coital bleeding | FAERS: 1 | US FAERS | |
| 71 | Cold sweat | FAERS: 1 | US FAERS | |
| 72 | Complication associated with device | FAERS: 1 | US FAERS | |
| 73 | Complication of device insertion | FAERS: 1 | US FAERS | |
| 74 | Complication of device removal | FAERS: 1 | US FAERS | |
| 75 | Crying | FAERS: 1 | US FAERS | |
| 76 | Cystitis | FAERS: 1 | US FAERS | |
| 77 | Dehydration | FAERS: 1 | US FAERS | |
| 78 | Device breakage | FAERS: 1 | US FAERS | |
| 79 | Device damage | FAERS: 1 | US FAERS | |
| 80 | Device migration | FAERS: 1 | US FAERS | |
| 81 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 82 | Dry skin | FAERS: 1 | US FAERS | |
| 83 | Dysuria | FAERS: 1 | US FAERS | |
| 84 | Endometrial disorder | FAERS: 1 | US FAERS | |
| 85 | Epistaxis | FAERS: 1 | US FAERS | |
| 86 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 87 | Female sex hormone level abnormal | FAERS: 1 | US FAERS | |
| 88 | Food craving | FAERS: 1 | US FAERS | |
| 89 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 90 | Genital rash | FAERS: 1 | US FAERS | |
| 91 | Hemiparesis | FAERS: 1 | US FAERS | |
| 92 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 93 | Implant expulsion | FAERS: 1 | US FAERS | |
| 94 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 95 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 96 | Intentional device misuse | FAERS: 1 | US FAERS | |
| 97 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 98 | Joint injury | FAERS: 1 | US FAERS | |
| 99 | Joint swelling | FAERS: 1 | US FAERS | |
| 100 | Lip swelling | FAERS: 1 | US FAERS | |
| 101 | Malabsorption from application site | FAERS: 1 | US FAERS | |
| 102 | Medical device site pain | FAERS: 1 | US FAERS | |
| 103 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 104 | Onychoclasis | FAERS: 1 | US FAERS | |
| 105 | Overdose | FAERS: 1 | US FAERS | |
| 106 | Palpitations | FAERS: 1 | US FAERS | |
| 107 | Pancreatitis | FAERS: 1 | US FAERS | |
| 108 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 109 | Product administration error | FAERS: 1 | US FAERS | |
| 110 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 111 | Product prescribing error | FAERS: 1 | US FAERS | |
| 112 | Product use issue | FAERS: 1 | US FAERS | |
| 113 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 114 | Skin reaction | FAERS: 1 | US FAERS | |
| 115 | Stress | FAERS: 1 | US FAERS | |
| 116 | Therapy change | FAERS: 1 | US FAERS | |
| 117 | Tremor | FAERS: 1 | US FAERS | |
| 118 | Urinary tract infection | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.