methotrexate polyglutamate
(FBOZXECLQNJBKD-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)CCC(C(=O)O)NC(=O)c1ccc(cc1)N(Cc1cnc2c(n1)c(N)nc(n2)N)C
- Molecular Formula:
- C20H22N8O5
- Molecular Weight:
- 454.439
- Log P:
- 1.8217
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 5
- TPSA:
- 210.54
- CAS Number(s):
- 60388-53-6; 82334-40-5
Synonym(s)
1.
methotrexate polyglutamate
2.
MTXGlu3
3.
methotrexate triglutamate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 2 | US FAERS | |
| 2 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 3 | Chest Pain | FAERS: 1 | US FAERS | |
| 4 | Epistaxis | FAERS: 1 | US FAERS | |
| 5 | Leukocytosis | FAERS: 1 | US FAERS | |
| 6 | Malnutrition | FAERS: 1 | US FAERS | |
| 7 | Palpitations | FAERS: 1 | US FAERS | |
| 8 | Pancytopenia | FAERS: 1 | US FAERS | |
| 9 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 10 | Post procedural complication | FAERS: 1 | US FAERS | |
| 11 | Product use issue | FAERS: 1 | US FAERS | |
| 12 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 13 | Thrombosis | FAERS: 1 | US FAERS | |
| 14 | Chemical and Drug Induced Liver Injury | 20954192 | CTD | |
| 15 | Gastrointestinal Diseases | 20954192 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120241
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.