delafloxacin
(DYDCPNMLZGFQTM-UHFFFAOYSA-N)
Structure
- SMILES
- OC1CN(C1)c1c(F)cc2c(c1Cl)n(cc(c2=O)C(=O)O)c1nc(N)c(cc1F)F
- Type(s)
- Approved; Investigational
- ATC code(s)
- J01MA23
- Molecular Formula:
- C18H12ClF3N4O4
- Molecular Weight:
- 440.760
- Log P:
- 2.5639
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 3
- TPSA:
- 121.68
- CAS Number(s):
- 189279-58-1
Synonym(s)
1.
delafloxacin
2.
1-(6-amino-3,5-difluoropyridin-2-yl)-8-chloro-6-fluoro-7-(3-hydroxyazetidin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid
3.
ABT 492
4.
ABT-492
5.
ABT492
6.
RX-3341
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Arthralgia | FAERS: 3 | US FAERS | |
| 2 | Nausea | FAERS: 3 | US FAERS | |
| 3 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 4 | Fatigue | FAERS: 2 | US FAERS | |
| 5 | Nervousness | FAERS: 2 | US FAERS | |
| 6 | Agitation | FAERS: 1 | US FAERS | |
| 7 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 8 | Anxiety | FAERS: 1 | US FAERS | |
| 9 | Back Pain | FAERS: 1 | US FAERS | |
| 10 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 11 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 12 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 13 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 14 | Headache | FAERS: 1 | US FAERS | |
| 15 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 16 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 17 | Leukopenia | FAERS: 1 | US FAERS | |
| 18 | Lip swelling | FAERS: 1 | US FAERS | |
| 19 | Malaise | FAERS: 1 | US FAERS | |
| 20 | Muscle tightness | FAERS: 1 | US FAERS | |
| 21 | Myalgia | FAERS: 1 | US FAERS | |
| 22 | Overgrowth fungal | FAERS: 1 | US FAERS | |
| 23 | Paranoia | FAERS: 1 | US FAERS | |
| 24 | Pruritus | FAERS: 1 | US FAERS | |
| 25 | Renal pain | FAERS: 1 | US FAERS | |
| 26 | Somnolence | FAERS: 1 | US FAERS | |
| 27 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 28 | Toothache | FAERS: 1 | US FAERS | |
| 29 | Urticaria | FAERS: 1 | US FAERS | |
| 30 | Vomiting | FAERS: 1 | US FAERS | |
| 31 | Community-Acquired Infections | 28598693 | CTD | |
| 32 | Pneumonia, Bacterial | 28598693 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120241
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.