Dexmethylphenidate Hydrochloride
(DUGOZIWVEXMGBE-CHWSQXEVSA-N)
Structure
- SMILES
- COC(=O)[C@H](c1ccccc1)[C@H]1CCCCN1
- Type(s)
- Approved; Investigational
- ATC code(s)
- N06BA11
- Molecular Formula:
- C14H19NO2
- Molecular Weight:
- 233.306
- Log P:
- 2.4141
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 38.33
- CAS Number(s):
- 40431-64-9; 40572-71-2
Synonym(s)
1.
Dexmethylphenidate Hydrochloride
2.
Dexmethylphenidate
3.
Focalin
4.
Focalin XR
5.
Hydrochloride, Dexmethylphenidate
6.
XR, Focalin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 38 | US FAERS | |
| 2 | Product substitution issue | FAERS: 31 | US FAERS | |
| 3 | Vomiting | FAERS: 9 | US FAERS | |
| 4 | Product quality issue | FAERS: 8 | US FAERS | |
| 5 | Product physical issue | FAERS: 6 | US FAERS | |
| 6 | Dizziness | FAERS: 5 | US FAERS | |
| 7 | Anger | FAERS: 4 | US FAERS | |
| 8 | Headache | FAERS: 4 | US FAERS | |
| 9 | Tachycardia | FAERS: 4 | US FAERS | |
| 10 | Wrong technique in product usage process | FAERS: 4 | US FAERS | |
| 11 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 12 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 13 | Adverse event | FAERS: 3 | US FAERS | |
| 14 | Educational problem | FAERS: 3 | US FAERS | |
| 15 | Nausea | FAERS: 3 | US FAERS | |
| 16 | Product use complaint | FAERS: 3 | US FAERS | |
| 17 | Agitation | FAERS: 2 | US FAERS | |
| 18 | Crying | FAERS: 2 | US FAERS | |
| 19 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 20 | Emotional disorder | FAERS: 2 | US FAERS | |
| 21 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 22 | Malaise | FAERS: 2 | US FAERS | |
| 23 | Syncope | FAERS: 2 | US FAERS | |
| 24 | Urticaria | FAERS: 2 | US FAERS | |
| 25 | Amnesia | FAERS: 1 | US FAERS | |
| 26 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 27 | Anxiety | FAERS: 1 | US FAERS | |
| 28 | Asthenia | FAERS: 1 | US FAERS | |
| 29 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 30 | Change in sustained attention | FAERS: 1 | US FAERS | |
| 31 | Compulsive lip biting | FAERS: 1 | US FAERS | |
| 32 | Depressed mood | FAERS: 1 | US FAERS | |
| 33 | Disease Progression | FAERS: 1 | US FAERS | |
| 34 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 35 | Dysarthria | FAERS: 1 | US FAERS | |
| 36 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 37 | Hemiparesis | FAERS: 1 | US FAERS | |
| 38 | Hypophagia | FAERS: 1 | US FAERS | |
| 39 | Hypotension | FAERS: 1 | US FAERS | |
| 40 | Impaired work ability | FAERS: 1 | US FAERS | |
| 41 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 42 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 43 | Lethargy | FAERS: 1 | US FAERS | |
| 44 | Memory impairment | FAERS: 1 | US FAERS | |
| 45 | Mental status changes | FAERS: 1 | US FAERS | |
| 46 | Mood swings | FAERS: 1 | US FAERS | |
| 47 | Nail picking | FAERS: 1 | US FAERS | |
| 48 | Nervousness | FAERS: 1 | US FAERS | |
| 49 | Oral pruritus | FAERS: 1 | US FAERS | |
| 50 | Product commingling | FAERS: 1 | US FAERS | |
| 51 | Product contamination | FAERS: 1 | US FAERS | |
| 52 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 53 | Product shape issue | FAERS: 1 | US FAERS | |
| 54 | Product size issue | FAERS: 1 | US FAERS | |
| 55 | Sneezing | FAERS: 1 | US FAERS | |
| 56 | Somnolence | FAERS: 1 | US FAERS | |
| 57 | Thirst | FAERS: 1 | US FAERS | |
| 58 | Throat irritation | FAERS: 1 | US FAERS | |
| 59 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 60 | Tremor | FAERS: 1 | US FAERS | |
| 61 | Unresponsive to stimuli | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.