Cibadrex
(CYHJUAIUPJVYDK-FKLPMGAJSA-N)
Structure
- SMILES
- Clc1cc2NCNS(=O)(=O)c2cc1S(=O)(=O)N.CCOC(=O)[C@@H](N[C@H]1CCc2c(N(C1=O)CC(=O)O)cccc2)CCc1ccccc1
- Molecular Formula:
- C31H36ClN5O9S2
- Molecular Weight:
- 722.229
- Log P:
- 6.0064
- Hydrogen Bond Acceptor:
- 14
- Hydrogen Bond Donor:
- 5
- TPSA:
- 231.06
- CAS Number(s):
- 151035-58-4
Synonym(s)
1.
Cibadrex
External Link(s)
| MeSH | C000594889 |
| PubChem Compound | 56841612 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dizziness | FAERS: 3 | US FAERS | |
| 2 | Nausea | FAERS: 2 | US FAERS | |
| 3 | Anxiety | FAERS: 1 | US FAERS | |
| 4 | Asthenia | FAERS: 1 | US FAERS | |
| 5 | Chest Pain | FAERS: 1 | US FAERS | |
| 6 | Chromatopsia | FAERS: 1 | US FAERS | |
| 7 | Contrast media allergy | FAERS: 1 | US FAERS | |
| 8 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 9 | Expired drug administered | FAERS: 1 | US FAERS | |
| 10 | Gingival Hyperplasia | FAERS: 1 | US FAERS | |
| 11 | Gout | FAERS: 1 | US FAERS | |
| 12 | Malaise | FAERS: 1 | US FAERS | |
| 13 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 14 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 15 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 16 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 17 | Product formulation issue | FAERS: 1 | US FAERS | |
| 18 | Product substitution issue | FAERS: 1 | US FAERS | |
| 19 | Productive Cough | FAERS: 1 | US FAERS | |
| 20 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 21 | Swelling | FAERS: 1 | US FAERS | |
| 22 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 23 | Urticaria | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120264
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.