Anaprox
(CMWTZPSULFXXJA-VIFPVBQESA-M)
Structure
- SMILES
- COc1ccc2c(c1)ccc(c2)[C@@H](C(=O)[O-])C
- Molecular Formula:
- C14H13O3-
- Molecular Weight:
- 229.251
- Log P:
- 1.7018
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 0
- TPSA:
- 49.36
- CAS Number(s):
- N/A
Synonym(s)
1.
Anaprox
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 2 | Urticaria | FAERS: 2 | US FAERS | |
| 3 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 4 | Angioedema | FAERS: 1 | US FAERS | |
| 5 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 6 | Asthenia | FAERS: 1 | US FAERS | |
| 7 | Dehydration | FAERS: 1 | US FAERS | |
| 8 | Dermo-hypodermitis | FAERS: 1 | US FAERS | |
| 9 | Epistaxis | FAERS: 1 | US FAERS | |
| 10 | Erythema | FAERS: 1 | US FAERS | |
| 11 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 12 | Ileitis | FAERS: 1 | US FAERS | |
| 13 | Inflammation | FAERS: 1 | US FAERS | |
| 14 | Lip swelling | FAERS: 1 | US FAERS | |
| 15 | Malaise | FAERS: 1 | US FAERS | |
| 16 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 17 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 18 | Peritonitis | FAERS: 1 | US FAERS | |
| 19 | Petechiae | FAERS: 1 | US FAERS | |
| 20 | Psoriasis | FAERS: 1 | US FAERS | |
| 21 | Sepsis | FAERS: 1 | US FAERS | |
| 22 | Shock | FAERS: 1 | US FAERS | |
| 23 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 24 | Urinary Retention | FAERS: 1 | US FAERS | |
| 25 | Vomiting | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120262
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.