balsalazide
(CKMOQBVBEGCJGW-UHFFFAOYSA-L)
Structure
- SMILES
- [O-]C(=O)CCNC(=O)c1ccc(cc1)N=Nc1ccc(c(c1)C(=O)O)[O-].[Na+].[Na+]
- Molecular Formula:
- C17H13N3Na2O6
- Molecular Weight:
- 401.281
- Log P:
- 2.2047
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 2
- TPSA:
- 154.31
- CAS Number(s):
- 82101-18-6; 213594-60-6
Synonym(s)
1.
balsalazide
2.
5-(carboxyethylcarbamoyl-4-phenylazo)salicylic acid
3.
BX 661A
4.
BX661A
5.
Colazal
6.
Colazide
7.
balsalazide disodium
8.
balsalazine
External Link(s)
| MeSH | C038637 |
| PubChem Compound | 136000818 135413496 |
| CHEMBL | CHEMBL1200760 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Chest Pain | FAERS: 3 | US FAERS | |
| 2 | Eosinophilic Pneumonia | FAERS: 3 | US FAERS | |
| 3 | Headache | FAERS: 3 | US FAERS | |
| 4 | Arthralgia | FAERS: 2 | US FAERS | |
| 5 | Drug ineffective | FAERS: 2 | US FAERS | |
| 6 | Dyspepsia | FAERS: 2 | US FAERS | |
| 7 | Hypotension | FAERS: 2 | US FAERS | |
| 8 | Malaise | FAERS: 2 | US FAERS | |
| 9 | Myocarditis | FAERS: 2 | US FAERS | |
| 10 | Nausea | FAERS: 2 | US FAERS | |
| 11 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 12 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 13 | Anal abscess | FAERS: 1 | US FAERS | |
| 14 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 15 | Bradycardia | FAERS: 1 | US FAERS | |
| 16 | Cellulitis | FAERS: 1 | US FAERS | |
| 17 | Chest discomfort | FAERS: 1 | US FAERS | |
| 18 | Dizziness | FAERS: 1 | US FAERS | |
| 19 | Fatigue | FAERS: 1 | US FAERS | |
| 20 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 21 | Flatulence | FAERS: 1 | US FAERS | |
| 22 | Gastritis | FAERS: 1 | US FAERS | |
| 23 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 24 | Inflammation | FAERS: 1 | US FAERS | |
| 25 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 26 | Medication residue | FAERS: 1 | US FAERS | |
| 27 | Myalgia | FAERS: 1 | US FAERS | |
| 28 | Neck Pain | FAERS: 1 | US FAERS | |
| 29 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 30 | Night sweats | FAERS: 1 | US FAERS | |
| 31 | Palpitations | FAERS: 1 | US FAERS | |
| 32 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 33 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 34 | Product substitution issue | FAERS: 1 | US FAERS | |
| 35 | Product use complaint | FAERS: 1 | US FAERS | |
| 36 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 37 | Throat irritation | FAERS: 1 | US FAERS | |
| 38 | Weight decreased | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120241
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.