Disopyramide
(CGDDQFMPGMYYQP-UHFFFAOYSA-N)
Structure
- SMILES
- OP(=O)(O)O.CC(N(C(C)C)CCC(c1ccccn1)(c1ccccc1)C(=O)N)C
- Molecular Formula:
- C21H32N3O5P
- Molecular Weight:
- 437.470
- Log P:
- 3.1336
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 4
- TPSA:
- 146.79
- CAS Number(s):
- 22059-60-5
Synonym(s)
1.
Disopyramide
2.
Diisopyramide
3.
Disopyramide Monohydrochloride
4.
Disopyramide Phosphate
5.
Disopyramide Phosphate (1:1)
6.
Disopyramide Phosphate (1:1), (+-)-Isomer
7.
Disopyramide Phosphate (1:1), (R)-Isomer
8.
Disopyramide Phosphate (1:1), (S)-Isomer
9.
Disopyramide, (+-)-Isomer
10.
Disopyramide, (R)-Isomer
11.
Disopyramide, (S)-Isomer
12.
Disopyramide, D-Tartrate (1:1), (S)-Isomer
13.
Disopyramide, L-Tartrate (1:1), (R)-Isomer
14.
Disopyramide, L-Tartrate (1:1), (S)-Isomer
15.
Disopyramide, L-Tartrate (1:2), (+-)-Isomer
16.
Disopyramide, L-Tartrate, (S)-isomer
17.
Norpace
18.
Palpitin
19.
Palpitine
20.
Rhythmodan
21.
Ritmilen
22.
Rythmilen
23.
SC-13957
24.
SC 13957
25.
SC13957
External Link(s)
| MeSH | D004206 |
| PubChem Compound | 30928 |
| ChEBI | 4658 |
| CHEMBL | CHEMBL1201020 |
| KEGG | cpd:C07740 dr:D00637 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 69 | US FAERS | |
| 2 | Malaise | FAERS: 12 | US FAERS | |
| 3 | Drug effect incomplete | FAERS: 10 | US FAERS | |
| 4 | Palpitations | FAERS: 10 | US FAERS | |
| 5 | Atrial Fibrillation | FAERS: 8 | US FAERS | |
| 6 | Product use in unapproved indication | FAERS: 8 | US FAERS | |
| 7 | Anxiety | FAERS: 7 | US FAERS | |
| 8 | Feeling abnormal | FAERS: 7 | US FAERS | |
| 9 | Asthenia | FAERS: 6 | US FAERS | |
| 10 | Dizziness | FAERS: 5 | US FAERS | |
| 11 | Chest Pain | FAERS: 4 | US FAERS | |
| 12 | Constipation | FAERS: 4 | US FAERS | |
| 13 | Drug dose omission | FAERS: 4 | US FAERS | |
| 14 | Dysuria | FAERS: 4 | US FAERS | |
| 15 | Fatigue | FAERS: 4 | US FAERS | |
| 16 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 17 | Stress | FAERS: 4 | US FAERS | |
| 18 | Syncope | FAERS: 4 | US FAERS | |
| 19 | Toxicity to various agents | FAERS: 4 | US FAERS | |
| 20 | Blindness | FAERS: 3 | US FAERS | |
| 21 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 22 | Intentional product misuse | FAERS: 3 | US FAERS | |
| 23 | Product use issue | FAERS: 3 | US FAERS | |
| 24 | Shock | FAERS: 3 | US FAERS | |
| 25 | Urinary Retention | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 27 | Accidental overdose | FAERS: 2 | US FAERS | |
| 28 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 29 | Apparent death | FAERS: 2 | US FAERS | |
| 30 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 31 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 32 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 33 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 34 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 35 | Dysgeusia | FAERS: 2 | US FAERS | |
| 36 | Expired product administered | FAERS: 2 | US FAERS | |
| 37 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 38 | Initial insomnia | FAERS: 2 | US FAERS | |
| 39 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 40 | Nervousness | FAERS: 2 | US FAERS | |
| 41 | Product dispensing error | FAERS: 2 | US FAERS | |
| 42 | Tremor | FAERS: 2 | US FAERS | |
| 43 | Unevaluable event | FAERS: 2 | US FAERS | |
| 44 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 45 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 46 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 47 | Alopecia | FAERS: 1 | US FAERS | |
| 48 | Back disorder | FAERS: 1 | US FAERS | |
| 49 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 50 | Bradycardia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 52 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 53 | Chest discomfort | FAERS: 1 | US FAERS | |
| 54 | Completed Suicide | FAERS: 1 | US FAERS | |
| 55 | Dehydration | FAERS: 1 | US FAERS | |
| 56 | Discomfort | FAERS: 1 | US FAERS | |
| 57 | Disease recurrence | FAERS: 1 | US FAERS | |
| 58 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 59 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 60 | Drug level decreased | FAERS: 1 | US FAERS | |
| 61 | Drug level fluctuating | FAERS: 1 | US FAERS | |
| 62 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 63 | Dry skin | FAERS: 1 | US FAERS | |
| 64 | Dysarthria | FAERS: 1 | US FAERS | |
| 65 | Dysphonia | FAERS: 1 | US FAERS | |
| 66 | Electrocardiogram ST-T change | FAERS: 1 | US FAERS | |
| 67 | Epistaxis | FAERS: 1 | US FAERS | |
| 68 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 69 | Flatulence | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 71 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 72 | Gout | FAERS: 1 | US FAERS | |
| 73 | Headache | FAERS: 1 | US FAERS | |
| 74 | Hypophagia | FAERS: 1 | US FAERS | |
| 75 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 76 | Lethargy | FAERS: 1 | US FAERS | |
| 77 | Limb discomfort | FAERS: 1 | US FAERS | |
| 78 | Lip swelling | FAERS: 1 | US FAERS | |
| 79 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 80 | Medication Error | FAERS: 1 | US FAERS | |
| 81 | Middle insomnia | FAERS: 1 | US FAERS | |
| 82 | Multimorbidity | FAERS: 1 | US FAERS | |
| 83 | Muscle tightness | FAERS: 1 | US FAERS | |
| 84 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 85 | Nausea | FAERS: 1 | US FAERS | |
| 86 | No adverse effect | FAERS: 1 | US FAERS | |
| 87 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 88 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 89 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 90 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 91 | Product container issue | FAERS: 1 | US FAERS | |
| 92 | Skin reaction | FAERS: 1 | US FAERS | |
| 93 | Somnolence | FAERS: 1 | US FAERS | |
| 94 | Tachycardia | FAERS: 1 | US FAERS | |
| 95 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 96 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 97 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 98 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 99 | Vertigo | FAERS: 1 | US FAERS | |
| 100 | Viral myocarditis | FAERS: 1 | US FAERS | |
| 101 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 102 | Dyspepsia | Canada Vigilance: 1 | Canada Vigilance | |
| 103 | Pruritus | Canada Vigilance: 1 | Canada Vigilance | |
| 104 | Thrombocytopenia | Canada Vigilance: 1 | Canada Vigilance | |
| 105 | Urticaria | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.