hylan
(BVOZFCOTOYGLGD-VPQOAABJSA-N)
Structure
- SMILES
- OCC1O[C@@H](COC[C@@H]2C(O[C@H](C([C@@H]2O)(C)O)OC[C@H]2C(NC(=O)C)[C@H](O)OC([C@H]2O)CO)C(=O)O)C([C@@H]([C@@H]1O)CO[C@@H]1OC(C(=O)O)[C@H]([C@H](C1O)O)O)NC(=O)C
- Molecular Formula:
- C33H54N2O23
- Molecular Weight:
- 846.781
- Log P:
- -7.3194
- Hydrogen Bond Acceptor:
- 25
- Hydrogen Bond Donor:
- 14
- TPSA:
- 399.71
- CAS Number(s):
- N/A
Synonym(s)
1.
hylan
2.
Synvisc
3.
hylan G-F 20
4.
hylan sodium
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pain | FAERS: 5 | US FAERS | |
| 2 | Joint swelling | FAERS: 4 | US FAERS | |
| 3 | Arthralgia | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Abasia | FAERS: 1 | US FAERS | |
| 5 | Arthritis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Erythema | FAERS: 1 | US FAERS | |
| 7 | Impaired work ability | FAERS: 1 | US FAERS | |
| 8 | Inflammation | FAERS: 1 | US FAERS | |
| 9 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 10 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 11 | Post procedural complication | FAERS: 1 | US FAERS | |
| 12 | Rebound effect | FAERS: 1 | US FAERS | |
| 13 | Swelling | FAERS: 1 | US FAERS | |
| 14 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 15 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 16 | Unevaluable event | FAERS: 1 | US FAERS | |
| 17 | Urticaria | FAERS: 1 | US FAERS | |
| 18 | Injection Site Reaction | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120262
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.