Oxymetazoline
(BEEDODBODQVSIM-UHFFFAOYSA-N)
Structure
- SMILES
- Cc1cc(c(c(c1CC1=NCCN1)C)O)C(C)(C)C.Cl
- Molecular Formula:
- C16H25ClN2O
- Molecular Weight:
- 296.836
- Log P:
- 3.4171
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 3
- TPSA:
- 44.62
- CAS Number(s):
- 2315-02-8
Synonym(s)
1.
Oxymetazoline
2.
Oxymetazoline Hydrochloride
3.
Hydrochloride, Oxymetazoline
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Application site erythema | FAERS: 30 | US FAERS | |
| 2 | Drug ineffective | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Therapeutic response unexpected | FAERS: 23 | US FAERS | |
| 4 | Product use issue | FAERS: 21 | US FAERS | |
| 5 | Anosmia | FAERS: 20 | US FAERS | |
| 6 | Application site pain | FAERS: 16 | US FAERS | |
| 7 | Rosacea | FAERS: 15 | US FAERS | |
| 8 | Ageusia | FAERS: 14 | US FAERS | |
| 9 | Expired product administered | FAERS: 12 | US FAERS | |
| 10 | Nasal discomfort | FAERS: 11 | US FAERS | |
| 11 | Product quality issue | FAERS: 11 | US FAERS | |
| 12 | Application site rash | FAERS: 10 | US FAERS | |
| 13 | Pain | FAERS: 10 | US FAERS | |
| 14 | Burning sensation | FAERS: 9 | US FAERS | |
| 15 | Drug Dependence | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | Erythema | FAERS: 9 | US FAERS | |
| 17 | Headache | FAERS: 8 | US FAERS | |
| 18 | Application site pruritus | FAERS: 7 | US FAERS | |
| 19 | Flushing | FAERS: 5 | US FAERS | |
| 20 | Stress | FAERS: 5 | US FAERS | |
| 21 | Application site irritation | FAERS: 4 | US FAERS | |
| 22 | Chest Pain | FAERS: 4 | US FAERS | |
| 23 | Dependence | FAERS: 4 | US FAERS | |
| 24 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 25 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 26 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 27 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 28 | Rebound effect | FAERS: 4 | US FAERS | |
| 29 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 30 | Application site dryness | FAERS: 3 | US FAERS | |
| 31 | Application site exfoliation | FAERS: 3 | US FAERS | |
| 32 | Epistaxis | FAERS: 3 | US FAERS | |
| 33 | Eye irritation | FAERS: 3 | US FAERS | |
| 34 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 35 | Rhinalgia | FAERS: 3 | US FAERS | |
| 36 | Skin irritation | FAERS: 3 | US FAERS | |
| 37 | Urticaria | FAERS: 3 | US FAERS | |
| 38 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 39 | Accidental exposure | FAERS: 2 | US FAERS | |
| 40 | Acne | FAERS: 2 | US FAERS | |
| 41 | Adverse event | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 43 | Application site acne | FAERS: 2 | US FAERS | |
| 44 | Application site inflammation | FAERS: 2 | US FAERS | |
| 45 | Application site warmth | FAERS: 2 | US FAERS | |
| 46 | Cardiac Tamponade | FAERS: 2 | US FAERS | |
| 47 | Drug administration error | FAERS: 2 | US FAERS | |
| 48 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 49 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 50 | Dysgeusia | FAERS: 2 | US FAERS | |
| 51 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 52 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 53 | Instillation site abnormal sensation | FAERS: 2 | US FAERS | |
| 54 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 55 | Keratitis | FAERS: 2 | US FAERS | |
| 56 | Medication Error | FAERS: 2 | US FAERS | |
| 57 | Nasal mucosal disorder | FAERS: 2 | US FAERS | |
| 58 | Product formulation issue | FAERS: 2 | US FAERS | |
| 59 | Pruritus | FAERS: 2 | US FAERS | |
| 60 | Sinus headache | FAERS: 2 | US FAERS | |
| 61 | Skin tightness | FAERS: 2 | US FAERS | |
| 62 | Sunburn | FAERS: 2 | US FAERS | |
| 63 | Throat irritation | FAERS: 2 | US FAERS | |
| 64 | Tremor | FAERS: 2 | US FAERS | |
| 65 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 66 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 67 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 68 | Amnesia | FAERS: 1 | US FAERS | |
| 69 | Anxiety | FAERS: 1 | US FAERS | |
| 70 | Application site burn | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 71 | Application site hypertrophy | FAERS: 1 | US FAERS | |
| 72 | Application site nodule | FAERS: 1 | US FAERS | |
| 73 | Application site pallor | FAERS: 1 | US FAERS | |
| 74 | Application site pustules | FAERS: 1 | US FAERS | |
| 75 | Application site swelling | FAERS: 1 | US FAERS | |
| 76 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 77 | Cataract operation | FAERS: 1 | US FAERS | |
| 78 | Chemical burns of eye | FAERS: 1 | US FAERS | |
| 79 | Chemical eye injury | FAERS: 1 | US FAERS | |
| 80 | Choking | FAERS: 1 | US FAERS | |
| 81 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 82 | Constipation | FAERS: 1 | US FAERS | |
| 83 | Crying | FAERS: 1 | US FAERS | |
| 84 | Culture positive | FAERS: 1 | US FAERS | |
| 85 | Deafness | FAERS: 1 | US FAERS | |
| 86 | Dehydration | FAERS: 1 | US FAERS | |
| 87 | Dermal absorption impaired | FAERS: 1 | US FAERS | |
| 88 | Discomfort | FAERS: 1 | US FAERS | |
| 89 | Drug abuser | FAERS: 1 | US FAERS | |
| 90 | Drug dose omission | FAERS: 1 | US FAERS | |
| 91 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 92 | Drug toxicity | FAERS: 1 | US FAERS | |
| 93 | Dysuria | FAERS: 1 | US FAERS | |
| 94 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 95 | Erysipelas | FAERS: 1 | US FAERS | |
| 96 | Euphoric mood | FAERS: 1 | US FAERS | |
| 97 | Expired drug administered | FAERS: 1 | US FAERS | |
| 98 | Eye Burns | FAERS: 1 | US FAERS | |
| 99 | Eye Redness | FAERS: 1 | US FAERS | |
| 100 | Eye pain | FAERS: 1 | US FAERS | |
| 101 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 102 | Facial Pain | FAERS: 1 | US FAERS | |
| 103 | Feeling jittery | FAERS: 1 | US FAERS | |
| 104 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 105 | General physical condition decreased | FAERS: 1 | US FAERS | |
| 106 | Hyperacusis | FAERS: 1 | US FAERS | |
| 107 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 108 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 109 | Injection site erythema | FAERS: 1 | US FAERS | |
| 110 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 111 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 112 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 113 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 114 | Malaise | FAERS: 1 | US FAERS | |
| 115 | Mantle cell lymphoma | FAERS: 1 | US FAERS | |
| 116 | Mydriasis | FAERS: 1 | US FAERS | |
| 117 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 118 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 119 | Nausea | FAERS: 1 | US FAERS | |
| 120 | Nerve injury | FAERS: 1 | US FAERS | |
| 121 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 122 | Pallor | FAERS: 1 | US FAERS | |
| 123 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 124 | Product container issue | FAERS: 1 | US FAERS | |
| 125 | Product container seal issue | FAERS: 1 | US FAERS | |
| 126 | Product label issue | FAERS: 1 | US FAERS | |
| 127 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 128 | Product packaging issue | FAERS: 1 | US FAERS | |
| 129 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 130 | Product storage error | FAERS: 1 | US FAERS | |
| 131 | Product substitution issue | FAERS: 1 | US FAERS | |
| 132 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 133 | Retching | FAERS: 1 | US FAERS | |
| 134 | Scab | FAERS: 1 | US FAERS | |
| 135 | Sinusitis | FAERS: 1 | US FAERS | |
| 136 | Staring | FAERS: 1 | US FAERS | |
| 137 | Swelling | FAERS: 1 | US FAERS | |
| 138 | Therapeutic product contamination | FAERS: 1 | US FAERS | |
| 139 | Thermal burn | FAERS: 1 | US FAERS | |
| 140 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 141 | Vasculitis | FAERS: 1 | US FAERS | |
| 142 | Wheezing | FAERS: 1 | US FAERS | |
| 143 | Wrong technique in drug usage process | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.