Benzphetamine
(ANFSNXAXVLRZCG-RSAXXLAASA-N)
Structure
- SMILES
- CN([C@H](Cc1ccccc1)C)Cc1ccccc1.Cl
- Molecular Formula:
- C17H22ClN
- Molecular Weight:
- 275.816
- Log P:
- 4.5516
- Hydrogen Bond Acceptor:
- 1
- Hydrogen Bond Donor:
- 1
- TPSA:
- 3.24
- CAS Number(s):
- 5411-22-3
Synonym(s)
1.
Benzphetamine
2.
Benzfetamine
3.
Didrex
External Link(s)
| MeSH | D001589 |
| PubChem Compound | 11558159 45266837 |
| ChEBI | 59169 |
| CHEMBL | CHEMBL3544906 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 4 | US FAERS | |
| 2 | Drug screen positive | FAERS: 3 | US FAERS | |
| 3 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 4 | Intentional self-injury | FAERS: 2 | US FAERS | |
| 5 | Burning sensation | FAERS: 1 | US FAERS | |
| 6 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 7 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 8 | Diverticulitis | FAERS: 1 | US FAERS | |
| 9 | Dizziness | FAERS: 1 | US FAERS | |
| 10 | Erythema | FAERS: 1 | US FAERS | |
| 11 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 12 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 13 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 14 | Skin irritation | FAERS: 1 | US FAERS | |
| 15 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 16 | Urine amphetamine positive | FAERS: 1 | US FAERS | |
| 17 | White blood cell count decreased | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120241
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.