abarelix
(AIWRTTMUVOZGPW-HSPKUQOVSA-N)
Structure
- SMILES
- OC[C@@H](C(=O)N([C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(=O)N)C)CCCCNC(C)C)CC(C)C)CC(=O)N)Cc1ccc(cc1)O)C)NC(=O)[C@H](NC(=O)[C@H](NC(=O)[C@@H](Cc1ccc2c(c1)cccc2)NC(=O)C)Cc1ccc(cc1)Cl)Cc1cccnc1
- Type(s)
- Approved; Investigational; Withdrawn
- ATC code(s)
- L02BX01
- Molecular Formula:
- C72H95ClN14O14
- Molecular Weight:
- 1416.060
- Log P:
- 6.0246
- Hydrogen Bond Acceptor:
- 28
- Hydrogen Bond Donor:
- 13
- TPSA:
- 424.98
- CAS Number(s):
- 183552-38-7
Synonym(s)
1.
abarelix
2.
PPI-149
3.
Plenaxis
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Bradycardia | FAERS: 3 | US FAERS | |
| 2 | Hypotension | FAERS: 3 | US FAERS | |
| 3 | Urticaria | FAERS: 3 | US FAERS | |
| 4 | Dizziness | FAERS: 2 | SIDER US FAERS | |
| 5 | Hypersensitivity | FAERS: 2 | SIDER US FAERS | |
| 6 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 7 | Asthenia | FAERS: 1 | SIDER US FAERS | |
| 8 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 9 | Burning sensation | FAERS: 1 | US FAERS | |
| 10 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 11 | Cold sweat | FAERS: 1 | US FAERS | |
| 12 | Dehydration | FAERS: 1 | US FAERS | |
| 13 | Disease Progression | FAERS: 1 | US FAERS | |
| 14 | Dysgeusia | FAERS: 1 | US FAERS | |
| 15 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 16 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 17 | Injection site irritation | FAERS: 1 | US FAERS | |
| 18 | Injection site pain | FAERS: 1 | US FAERS | |
| 19 | No adverse effect | FAERS: 1 | US FAERS | |
| 20 | Presyncope | FAERS: 1 | US FAERS | |
| 21 | Pruritus | FAERS: 1 | US FAERS | |
| 22 | Purulence | FAERS: 1 | US FAERS | |
| 23 | Rash erythematous | FAERS: 1 | US FAERS | |
| 24 | Vomiting | FAERS: 1 | US FAERS | |
| 25 | Back Pain | SIDER | ||
| 26 | Blood triglycerides increased | SIDER | ||
| 27 | Constipation | SIDER | ||
| 28 | Dysuria | SIDER | ||
| 29 | Fatigue | SIDER | ||
| 30 | Headache | SIDER | ||
| 31 | Nausea | SIDER | ||
| 32 | Nipple pain | SIDER | ||
| 33 | Nipple tenderness | SIDER | ||
| 34 | Pain | SIDER | ||
| 35 | Serum triglycerides increased | SIDER | ||
| 36 | Urinary Retention | SIDER | ||
| 37 | Urinary tract infection | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.