Zyrtec-D 12 hour
(ZOPQOWMEWBFVAR-PXRPMCEGSA-N)
Structure
- SMILES
- OC(=O)COCCN1CCN(CC1)C(c1ccc(cc1)Cl)c1ccccc1.CN[C@H]([C@H](c1ccccc1)O)C
- Molecular Formula:
- C31H40ClN3O4
- Molecular Weight:
- 554.120
- Log P:
- 4.7428
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 3
- TPSA:
- 85.27
- CAS Number(s):
- 913966-97-9
Synonym(s)
1.
Zyrtec-D 12 hour
External Link(s)
| PubChem Compound | 9850627 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pruritus | FAERS: 9 | US FAERS | |
| 2 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 3 | Malaise | FAERS: 5 | US FAERS | |
| 4 | Anger | FAERS: 3 | US FAERS | |
| 5 | Headache | FAERS: 3 | US FAERS | |
| 6 | Palpitations | FAERS: 3 | US FAERS | |
| 7 | Vomiting | FAERS: 3 | US FAERS | |
| 8 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 9 | Asthma | FAERS: 2 | US FAERS | |
| 10 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 11 | Bronchospasm | FAERS: 2 | US FAERS | |
| 12 | Chest discomfort | FAERS: 2 | US FAERS | |
| 13 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 14 | Dependence | FAERS: 2 | US FAERS | |
| 15 | Dizziness | FAERS: 2 | US FAERS | |
| 16 | Drug Dependence | FAERS: 2 | US FAERS | |
| 17 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 18 | Drug ineffective | FAERS: 2 | US FAERS | |
| 19 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 20 | Expired drug administered | FAERS: 2 | US FAERS | |
| 21 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 22 | Pain | FAERS: 2 | US FAERS | |
| 23 | Paranasal sinus discomfort | FAERS: 2 | US FAERS | |
| 24 | Product quality issue | FAERS: 2 | US FAERS | |
| 25 | Sinusitis | FAERS: 2 | US FAERS | |
| 26 | Sneezing | FAERS: 2 | US FAERS | |
| 27 | Stool analysis abnormal | FAERS: 2 | US FAERS | |
| 28 | Stress | FAERS: 2 | US FAERS | |
| 29 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 30 | Urticaria | FAERS: 2 | US FAERS | |
| 31 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 32 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 33 | Anosmia | FAERS: 1 | US FAERS | |
| 34 | Arthralgia | FAERS: 1 | US FAERS | |
| 35 | Back Pain | FAERS: 1 | US FAERS | |
| 36 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 37 | Chest Pain | FAERS: 1 | US FAERS | |
| 38 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 39 | Constipation | FAERS: 1 | US FAERS | |
| 40 | Dehydration | FAERS: 1 | US FAERS | |
| 41 | Discomfort | FAERS: 1 | US FAERS | |
| 42 | Drug dose omission | FAERS: 1 | US FAERS | |
| 43 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 44 | Economic problem | FAERS: 1 | US FAERS | |
| 45 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 46 | Impaired work ability | FAERS: 1 | US FAERS | |
| 47 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 48 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 49 | Nausea | FAERS: 1 | US FAERS | |
| 50 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 51 | Presyncope | FAERS: 1 | US FAERS | |
| 52 | Purpura | FAERS: 1 | US FAERS | |
| 53 | Rash erythematous | FAERS: 1 | US FAERS | |
| 54 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 55 | Unevaluable event | FAERS: 1 | US FAERS | |
| 56 | Wheezing | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.