Duzallo
(ZAIDWUNPNBKVGO-UHFFFAOYSA-N)
Structure
- SMILES
- O=c1[nH]cnc2c1cn[nH]2.OC(=O)CSc1nnc(n1c1ccc(c2c1cccc2)C1CC1)Br
- Molecular Formula:
- C22H18BrN7O3S
- Molecular Weight:
- 540.392
- Log P:
- 3.8833
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 3
- TPSA:
- 167.74
- CAS Number(s):
- 1372858-63-3
Synonym(s)
1.
Duzallo
External Link(s)
| MeSH | C000626024 |
| PubChem Compound | 137083676 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Gout | FAERS: 5 | US FAERS | |
| 2 | Medication Error | FAERS: 3 | US FAERS | |
| 3 | Dizziness | FAERS: 2 | US FAERS | |
| 4 | Drug ineffective | FAERS: 2 | US FAERS | |
| 5 | Nausea | FAERS: 2 | US FAERS | |
| 6 | Pain | FAERS: 2 | US FAERS | |
| 7 | Vomiting | FAERS: 2 | US FAERS | |
| 8 | Amnesia | FAERS: 1 | US FAERS | |
| 9 | Drug dose omission | FAERS: 1 | US FAERS | |
| 10 | Dysphonia | FAERS: 1 | US FAERS | |
| 11 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 12 | Feeling jittery | FAERS: 1 | US FAERS | |
| 13 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 14 | Malaise | FAERS: 1 | US FAERS | |
| 15 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 16 | Nerve injury | FAERS: 1 | US FAERS | |
| 17 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 18 | Product dose omission | FAERS: 1 | US FAERS | |
| 19 | Pruritus | FAERS: 1 | US FAERS | |
| 20 | Renal pain | FAERS: 1 | US FAERS | |
| 21 | Tachycardia | FAERS: 1 | US FAERS | |
| 22 | Tinnitus | FAERS: 1 | US FAERS | |
| 23 | Tremor | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.