orthovisc
(YWIVKILSMZOHHF-QJZPQSOGSA-N)
Structure
- SMILES
- OC[C@H]1O[C@@H](O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)O[C@@H]2[C@@H](NC(=O)C)[C@H](O)O[C@@H]([C@H]2O)CO)C(=O)O)[C@@H]([C@H]([C@@H]1O)O[C@@H]1O[C@H](C(=O)O)[C@H]([C@@H]([C@H]1O)O)O)NC(=O)C.[Na+]
- Molecular Formula:
- C28H44N2NaO23+
- Molecular Weight:
- 799.638
- Log P:
- -8.4948
- Hydrogen Bond Acceptor:
- 25
- Hydrogen Bond Donor:
- 14
- TPSA:
- 399.71
- CAS Number(s):
- N/A
Synonym(s)
1.
orthovisc
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pain | FAERS: 5 | US FAERS | |
| 2 | Arthralgia | FAERS: 3 | US FAERS | |
| 3 | Nausea | FAERS: 3 | US FAERS | |
| 4 | Dizziness | FAERS: 2 | US FAERS | |
| 5 | Headache | FAERS: 2 | US FAERS | |
| 6 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 7 | Ataxia | FAERS: 1 | US FAERS | |
| 8 | Back Pain | FAERS: 1 | US FAERS | |
| 9 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 10 | Burning sensation | FAERS: 1 | US FAERS | |
| 11 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 12 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 13 | Drug ineffective | FAERS: 1 | US FAERS | |
| 14 | Dry skin | FAERS: 1 | US FAERS | |
| 15 | Ecchymosis | FAERS: 1 | US FAERS | |
| 16 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 17 | Gout | FAERS: 1 | US FAERS | |
| 18 | Hemiplegia | FAERS: 1 | US FAERS | |
| 19 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 20 | Hypersomnia | FAERS: 1 | US FAERS | |
| 21 | Injection site erythema | FAERS: 1 | US FAERS | |
| 22 | Injection site pain | FAERS: 1 | US FAERS | |
| 23 | Joint swelling | FAERS: 1 | US FAERS | |
| 24 | Ligament rupture | FAERS: 1 | US FAERS | |
| 25 | Limb discomfort | FAERS: 1 | US FAERS | |
| 26 | Miliaria | FAERS: 1 | US FAERS | |
| 27 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 28 | Swelling | FAERS: 1 | US FAERS | |
| 29 | Transmission of an infectious agent via a medicinal product | FAERS: 1 | US FAERS | |
| 30 | Vertigo | FAERS: 1 | US FAERS | |
| 31 | Vomiting | FAERS: 1 | US FAERS | |
| 32 | Walking aid user | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.