Fluorometholone acetate
(YRFXGQHBPBMFHW-SBTZIJSASA-N)
Structure
- SMILES
- O=C1C=C[C@]2(C(=C1)[C@@H](C)C[C@@H]1[C@]2(F)[C@@H](O)C[C@]2([C@H]1CC[C@]2(OC(=O)C)C(=O)C)C)C
- Molecular Formula:
- C24H31FO5
- Molecular Weight:
- 418.498
- Log P:
- 3.4941
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 80.67
- CAS Number(s):
- 3801-06-7
Synonym(s)
1.
Fluorometholone acetate
External Link(s)
| PubChem Compound | 240767 |
| ChEBI | 78354 |
| CHEMBL | CHEMBL1201064 |
| DrugCentral | 4647 |
| KEGG | cpd:C14629 dr:D04221 |
| ZINC | 4213357 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Eye irritation | FAERS: 2 | US FAERS | |
| 2 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 3 | Burning sensation | FAERS: 1 | US FAERS | |
| 4 | Corneal defect | FAERS: 1 | US FAERS | |
| 5 | Corneal epithelium defect | FAERS: 1 | US FAERS | |
| 6 | Eye pain | FAERS: 1 | US FAERS | |
| 7 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 8 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 9 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 10 | Pain | FAERS: 1 | US FAERS | |
| 11 | Product container issue | FAERS: 1 | US FAERS | |
| 12 | Retinal Detachment | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120262
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.