nitazoxanide
(YQNQNVDNTFHQSW-UHFFFAOYSA-N)
Structure
- SMILES
- CC(=O)Oc1ccccc1C(=O)Nc1ncc(s1)[N+](=O)[O-]
- Type(s)
- Approved; Investigational; Vet_approved
- ATC code(s)
- P01AX11
- Molecular Formula:
- C12H9N3O5S
- Molecular Weight:
- 307.282
- Log P:
- 2.8251
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 142.35
- CAS Number(s):
- 55981-09-4
Synonym(s)
1.
nitazoxanide
2.
Alinia
3.
Colufase
4.
Cryptaz
5.
Daxon
6.
Heliton
7.
NTZ
8.
Taenitaz
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Chromaturia | FAERS: 19 | SIDER US FAERS | |
| 2 | Nausea | FAERS: 18 | SIDER US FAERS | |
| 3 | Headache | FAERS: 10 | SIDER US FAERS | |
| 4 | Abdominal Pain | FAERS: 6 | SIDER US FAERS | |
| 5 | Arthralgia | FAERS: 5 | US FAERS | |
| 6 | Fatigue | FAERS: 5 | US FAERS | |
| 7 | Urticaria | FAERS: 5 | US FAERS | |
| 8 | Vomiting | FAERS: 4 | SIDER US FAERS | |
| 9 | Dizziness | FAERS: 3 | SIDER US FAERS | |
| 10 | Drug ineffective | FAERS: 3 | US FAERS | |
| 11 | Dysuria | FAERS: 3 | SIDER US FAERS | |
| 12 | Hypersensitivity | FAERS: 3 | SIDER US FAERS | |
| 13 | Tachycardia | FAERS: 3 | SIDER US FAERS | |
| 14 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 15 | Erythema | FAERS: 2 | US FAERS | |
| 16 | Feeling abnormal | FAERS: 2 | SIDER US FAERS | |
| 17 | Lip swelling | FAERS: 2 | US FAERS | |
| 18 | Pain | FAERS: 2 | SIDER US FAERS | |
| 19 | Pallor | FAERS: 2 | US FAERS | |
| 20 | Pruritus | FAERS: 2 | SIDER US FAERS | |
| 21 | Tremor | FAERS: 2 | SIDER US FAERS | |
| 22 | Weight decreased | FAERS: 2 | US FAERS | |
| 23 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 24 | Accidental overdose | FAERS: 1 | US FAERS | |
| 25 | Aphonia | FAERS: 1 | US FAERS | |
| 26 | Asthenia | FAERS: 1 | SIDER US FAERS | |
| 27 | Atelectasis | FAERS: 1 | US FAERS | |
| 28 | Burning sensation | FAERS: 1 | US FAERS | |
| 29 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 30 | Chest Pain | FAERS: 1 | US FAERS | |
| 31 | Chest discomfort | FAERS: 1 | US FAERS | |
| 32 | Chills | FAERS: 1 | SIDER US FAERS | |
| 33 | Dehydration | FAERS: 1 | US FAERS | |
| 34 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 35 | Dysarthria | FAERS: 1 | US FAERS | |
| 36 | Dysgeusia | FAERS: 1 | US FAERS | |
| 37 | Dyspepsia | FAERS: 1 | SIDER US FAERS | |
| 38 | Flushing | FAERS: 1 | US FAERS | |
| 39 | Hepatitis | FAERS: 1 | US FAERS | |
| 40 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 41 | Joint swelling | FAERS: 1 | US FAERS | |
| 42 | Malaise | FAERS: 1 | SIDER US FAERS | |
| 43 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 44 | Ocular icterus | FAERS: 1 | US FAERS | |
| 45 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 46 | Palpitations | FAERS: 1 | US FAERS | |
| 47 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 48 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 49 | Productive Cough | FAERS: 1 | US FAERS | |
| 50 | Rash erythematous | FAERS: 1 | US FAERS | |
| 51 | Respiratory distress | FAERS: 1 | US FAERS | |
| 52 | Retching | FAERS: 1 | US FAERS | |
| 53 | Rhinitis | FAERS: 1 | SIDER US FAERS | |
| 54 | Somnolence | FAERS: 1 | SIDER US FAERS | |
| 55 | Syncope | FAERS: 1 | SIDER US FAERS | |
| 56 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 57 | Thirst | FAERS: 1 | SIDER US FAERS | |
| 58 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 59 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 60 | Alanine Aminotransferase Increased | SIDER | ||
| 61 | Anorexia | SIDER | ||
| 62 | Back Pain | SIDER | ||
| 63 | Blood creatinine increased | SIDER | ||
| 64 | Constipation | SIDER | ||
| 65 | Cramps of lower extremities | SIDER | ||
| 66 | Creatinine increased | SIDER | ||
| 67 | Dermatitis | SIDER | ||
| 68 | Discomfort | SIDER | ||
| 69 | Epistaxis | SIDER | ||
| 70 | Flatulence | SIDER | ||
| 71 | Gastrointestinal Pain | SIDER | ||
| 72 | Infection | SIDER | ||
| 73 | Influenza | SIDER | ||
| 74 | Leukocytosis | SIDER | ||
| 75 | Metrorrhagia | SIDER | ||
| 76 | Musculoskeletal discomfort | SIDER | ||
| 77 | Myalgia | SIDER | ||
| 78 | Pelvic Pain | SIDER | ||
| 79 | Pharyngitis | SIDER | ||
| 80 | Renal pain | SIDER | ||
| 81 | Shock | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.