Esketamine
(YQEZLKZALYSWHR-ZDUSSCGKSA-N)
Structure
- SMILES
- CN[C@@]1(CCCCC1=O)c1ccccc1Cl
- Type(s)
- Approved; Investigational
- ATC code(s)
- N01AX14
- Molecular Formula:
- C13H16ClNO
- Molecular Weight:
- 237.725
- Log P:
- 3.2887
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 29.1
- CAS Number(s):
- 33643-46-8
Synonym(s)
1.
Esketamine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dissociation | FAERS: 8 | US FAERS | |
| 2 | Nausea | FAERS: 7 | US FAERS | |
| 3 | Dizziness | FAERS: 6 | US FAERS | |
| 4 | Vomiting | FAERS: 6 | US FAERS | |
| 5 | Anxiety | FAERS: 5 | US FAERS | |
| 6 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 7 | Headache | FAERS: 3 | US FAERS | |
| 8 | Drug ineffective | FAERS: 2 | US FAERS | |
| 9 | Dysgeusia | FAERS: 2 | US FAERS | |
| 10 | Lethargy | FAERS: 2 | US FAERS | |
| 11 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 12 | Somnolence | FAERS: 2 | US FAERS | |
| 13 | Agitation | FAERS: 1 | US FAERS | |
| 14 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 15 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 16 | Depressed mood | FAERS: 1 | US FAERS | |
| 17 | Dysarthria | FAERS: 1 | US FAERS | |
| 18 | Emotional distress | FAERS: 1 | US FAERS | |
| 19 | Epistaxis | FAERS: 1 | US FAERS | |
| 20 | Euphoric mood | FAERS: 1 | US FAERS | |
| 21 | Fatigue | FAERS: 1 | US FAERS | |
| 22 | Fracture | FAERS: 1 | US FAERS | |
| 23 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 24 | Immobile | FAERS: 1 | US FAERS | |
| 25 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 26 | Medication Error | FAERS: 1 | US FAERS | |
| 27 | Mental impairment | FAERS: 1 | US FAERS | |
| 28 | Overdose | FAERS: 1 | US FAERS | |
| 29 | Pain | FAERS: 1 | US FAERS | |
| 30 | Palpitations | FAERS: 1 | US FAERS | |
| 31 | Product quality issue | FAERS: 1 | US FAERS | |
| 32 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 33 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 34 | Therapeutic response unexpected | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120269
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.