Cyanokit
(YOZNUFWCRFCGIH-WZHZPDAFSA-K)
Structure
- SMILES
- OC[C@H]1O[C@@H]([C@@H]([C@@H]1OP(=O)(O[C@@H](CNC(=O)CC[C@@]1(C)/C/2=C(\C)/C3=N/C(=C\C4=N/C(=C(\C5=N[C@]([C@@H]([C@@H]1CC(=O)N)[N-]2)(C)[C@@](C)(CC(=O)N)[C@@H]5CCC(=O)N)/C)/[C@@]([C@@H]4CCC(=O)N)(C)CC(=O)N)/C([C@@H]3CCC(=O)N)(C)C)C)[O-])O)n1cnc2c1cc(C)c(c2)C.[Co+3].[OH-]
- Type(s)
- Approved
- ATC code(s)
- B03BA03; B03BA53; V03AB33
- Molecular Formula:
- C62H89CoN13O15P
- Molecular Weight:
- 1346.360
- Log P:
- 6.4387
- Hydrogen Bond Acceptor:
- 27
- Hydrogen Bond Donor:
- 10
- TPSA:
- 483.69
- CAS Number(s):
- 13422-51-0
Synonym(s)
1.
Cyanokit
External Link(s)
| PubChem Compound | 44475014 70678542 |
| ChEBI | 27786 |
| CHEMBL | CHEMBL2103737 |
| DrugBank | DB00200 |
| KEGG | cpd:C08230 dr:D01027 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Chromaturia | FAERS: 14 | US FAERS | |
| 2 | Product use in unapproved indication | FAERS: 5 | US FAERS | |
| 3 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 4 | Drug toxicity | FAERS: 2 | US FAERS | |
| 5 | Pain | FAERS: 2 | US FAERS | |
| 6 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 7 | Blood test normal | FAERS: 1 | US FAERS | |
| 8 | Bradycardia | FAERS: 1 | US FAERS | |
| 9 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 10 | Crystal urine present | FAERS: 1 | US FAERS | |
| 11 | Device interaction | FAERS: 1 | US FAERS | |
| 12 | Device leakage | FAERS: 1 | US FAERS | |
| 13 | Device material issue | FAERS: 1 | US FAERS | |
| 14 | Drug ineffective | FAERS: 1 | US FAERS | |
| 15 | Erythema | FAERS: 1 | US FAERS | |
| 16 | Extravasation | FAERS: 1 | US FAERS | |
| 17 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 18 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 19 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 20 | Medical device complication | FAERS: 1 | US FAERS | |
| 21 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 22 | Overdose | FAERS: 1 | US FAERS | |
| 23 | Product use issue | FAERS: 1 | US FAERS | |
| 24 | Rash erythematous | FAERS: 1 | US FAERS | |
| 25 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 26 | Renal venous congestion | FAERS: 1 | US FAERS | |
| 27 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 28 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120262
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.