Acetic acid;(2S)-N-[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2R)-1-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(2S)-2-(ethylcarbamoyl)pyrrolidin-1-yl]-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-(1H-indol-2-yl)-1-oxopropan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-5-oxopyrrolidine-2-carboxamide
(YFDMUNOZURYOCP-XNHQSDQCSA-N)
Structure
- SMILES
- CC(=O)O.CCNC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]1CCC(=O)N1)Cc1cnc[nH]1)Cc1cc2c([nH]1)cccc2)CO)Cc1ccc(cc1)O)CC(C)C)CC(C)C)CCCN=C(N)N
- Molecular Formula:
- C61H88N16O14
- Molecular Weight:
- 1269.450
- Log P:
- 3.4473
- Hydrogen Bond Acceptor:
- 28
- Hydrogen Bond Donor:
- 16
- TPSA:
- 468.84
- CAS Number(s):
- N/A
Synonym(s)
1.
Acetic acid;(2S)-N-[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2R)-1-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(2S)-2-(ethylcarbamoyl)pyrrolidin-1-yl]-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-(1H-indol-2-yl)-1-oxopropan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-5-oxopyrrolidine-2-carboxamide
External Link(s)
| PubChem Compound | 73415782 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pain | FAERS: 3 | US FAERS | |
| 2 | Anxiety | FAERS: 2 | US FAERS | |
| 3 | Dizziness | FAERS: 2 | US FAERS | |
| 4 | Drug ineffective | FAERS: 2 | US FAERS | |
| 5 | Fatigue | FAERS: 2 | US FAERS | |
| 6 | Injection site pain | FAERS: 2 | US FAERS | |
| 7 | Mood swings | FAERS: 2 | US FAERS | |
| 8 | Nausea | FAERS: 2 | US FAERS | |
| 9 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 10 | Adenoidal disorder | FAERS: 1 | US FAERS | |
| 11 | Adenoidectomy | FAERS: 1 | US FAERS | |
| 12 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 13 | Arthralgia | FAERS: 1 | US FAERS | |
| 14 | Asthma | FAERS: 1 | US FAERS | |
| 15 | Blood testosterone increased | FAERS: 1 | US FAERS | |
| 16 | Breast tenderness | FAERS: 1 | US FAERS | |
| 17 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 18 | Cold sweat | FAERS: 1 | US FAERS | |
| 19 | Depressed mood | FAERS: 1 | US FAERS | |
| 20 | Discomfort | FAERS: 1 | US FAERS | |
| 21 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 22 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 23 | Folliculitis | FAERS: 1 | US FAERS | |
| 24 | Headache | FAERS: 1 | US FAERS | |
| 25 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 26 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 27 | Injection site abscess | FAERS: 1 | US FAERS | |
| 28 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 29 | Joint swelling | FAERS: 1 | US FAERS | |
| 30 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 31 | Night sweats | FAERS: 1 | US FAERS | |
| 32 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 33 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 34 | Tonsillectomy | FAERS: 1 | US FAERS | |
| 35 | Tremor | FAERS: 1 | US FAERS | |
| 36 | Wheezing | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.