Dalcaine
(YECIFGHRMFEPJK-UHFFFAOYSA-N)
Structure
- SMILES
- CC[NH+](CC(=O)Nc1c(C)cccc1C)CC.O.[Cl-]
- Molecular Formula:
- C14H25ClN2O2
- Molecular Weight:
- 288.813
- Log P:
- -1.8207
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 3
- TPSA:
- 42.77
- CAS Number(s):
- 6108-05-0
Synonym(s)
1.
Dalcaine
2.
Lidocaine hydrochloride monohydrate
External Link(s)
| PubChem Compound | 16219577 22483 |
| ChEBI | 60791 |
| CHEMBL | CHEMBL1200409 |
| KEGG | dr:D08127 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 5 | US FAERS | |
| 2 | Accidental overdose | FAERS: 1 | US FAERS | |
| 3 | Anxiety | FAERS: 1 | US FAERS | |
| 4 | Bradycardia | FAERS: 1 | US FAERS | |
| 5 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 6 | Crying | FAERS: 1 | US FAERS | |
| 7 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 8 | Dizziness | FAERS: 1 | US FAERS | |
| 9 | Injection site erythema | FAERS: 1 | US FAERS | |
| 10 | Injection site urticaria | FAERS: 1 | US FAERS | |
| 11 | Medication Error | FAERS: 1 | US FAERS | |
| 12 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 13 | Product quality issue | FAERS: 1 | US FAERS | |
| 14 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 15 | Wrong technique in drug usage process | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.