triamcinolone diacetate
(XGMPVBXKDAHORN-RBWIMXSLSA-N)
Structure
- SMILES
- CC(=O)O[C@@H]1C[C@@H]2[C@]([C@@]1(O)C(=O)COC(=O)C)(C)C[C@@H]([C@]1([C@H]2CCC2=CC(=O)C=C[C@]12C)F)O
- Molecular Formula:
- C25H31FO8
- Molecular Weight:
- 478.507
- Log P:
- 1.7621
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 2
- TPSA:
- 127.2
- CAS Number(s):
- 67-78-7
Synonym(s)
1.
triamcinolone diacetate
2.
Polcartolone
3.
Polcortolon
External Link(s)
| MeSH | C030262 |
| PubChem Compound | 6216 |
| BindingDB | 50247986 |
| ChEBI | 9669 |
| CHEMBL | CHEMBL1200449 |
| DrugCentral | 2727 |
| KEGG | cpd:C08184 dr:D00984 |
| ZINC | 3875441 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Abscess | FAERS: 1 | US FAERS | |
| 2 | Arthropathy | FAERS: 1 | US FAERS | |
| 3 | Cataract | FAERS: 1 | US FAERS | |
| 4 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 5 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 6 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 7 | Injection site pain | FAERS: 1 | US FAERS | |
| 8 | Intentional misuse | FAERS: 1 | US FAERS | |
| 9 | Iritis | FAERS: 1 | US FAERS | |
| 10 | Joint destruction | FAERS: 1 | US FAERS | |
| 11 | Monoplegia | FAERS: 1 | US FAERS | |
| 12 | Mydriasis | FAERS: 1 | US FAERS | |
| 13 | Overdose | FAERS: 1 | US FAERS | |
| 14 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 15 | Polyradiculopathy | 16904497 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120240
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.