Norgestrel
(WWYNJERNGUHSAO-CULCCENASA-N)
Structure
- SMILES
- C#CC1(O)CC[C@@H]2[C@]1(CC)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12
- Molecular Formula:
- C21H28O2
- Molecular Weight:
- 312.446
- Log P:
- 3.8826
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 37.3
- CAS Number(s):
- 6533-00-2
Synonym(s)
1.
Norgestrel
External Link(s)
| PubChem Compound | 16051930 |
| CHEMBL | CHEMBL2107797 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 2 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 3 | Arthralgia | FAERS: 1 | US FAERS | |
| 4 | Breast hyperplasia | FAERS: 1 | US FAERS | |
| 5 | Chest Pain | FAERS: 1 | US FAERS | |
| 6 | Crying | FAERS: 1 | US FAERS | |
| 7 | Cyst | FAERS: 1 | US FAERS | |
| 8 | Emotional disorder | FAERS: 1 | US FAERS | |
| 9 | Emotional distress | FAERS: 1 | US FAERS | |
| 10 | Fatigue | FAERS: 1 | US FAERS | |
| 11 | Metaplasia | FAERS: 1 | US FAERS | |
| 12 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 13 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 14 | Skin lesion | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120265
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.