Risperidon
(WDNMHZRFIIOXOD-UHFFFAOYSA-N)
Structure
- SMILES
- Fc1ccc2c(c1)ONC2C1CCN(CC1)CCc1c(C)nc2n(c1=O)CCCC2
- Molecular Formula:
- C23H29FN4O2
- Molecular Weight:
- 412.500
- Log P:
- 3.1866
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 59.39
- CAS Number(s):
- N/A
Synonym(s)
1.
Risperidon
External Link(s)
| PubChem Compound | 44402564 |
| BindingDB | 50409962 |
| CHEMBL | CHEMBL364512 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 2 | Ileus | FAERS: 2 | US FAERS | |
| 3 | Abasia | FAERS: 1 | US FAERS | |
| 4 | Accidental overdose | FAERS: 1 | US FAERS | |
| 5 | Apathy | FAERS: 1 | US FAERS | |
| 6 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 7 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 8 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 9 | Catatonia | FAERS: 1 | US FAERS | |
| 10 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 11 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 12 | Constipation | FAERS: 1 | US FAERS | |
| 13 | Delirium | FAERS: 1 | US FAERS | |
| 14 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 15 | Dysuria | FAERS: 1 | US FAERS | |
| 16 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 17 | Gaze palsy | FAERS: 1 | US FAERS | |
| 18 | Growth retardation | FAERS: 1 | US FAERS | |
| 19 | Infection | FAERS: 1 | US FAERS | |
| 20 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 21 | Nocturia | FAERS: 1 | US FAERS | |
| 22 | Pneumonia | FAERS: 1 | US FAERS | |
| 23 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 24 | Subileus | FAERS: 1 | US FAERS | |
| 25 | Thrombosis | FAERS: 1 | US FAERS | |
| 26 | Unevaluable event | FAERS: 1 | US FAERS | |
| 27 | Vomiting | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.