Tussicaps
(UUEZOEBHFHYMGR-RNWHKREASA-N)
Structure
- SMILES
- CN(CCC(c1ccccn1)c1ccc(cc1)Cl)C.COc1ccc2c3c1O[C@@H]1[C@@]43CCN([C@H](C2)[C@@H]4CCC1=O)C
- Molecular Formula:
- C34H40ClN3O3
- Molecular Weight:
- 574.153
- Log P:
- 5.6898
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 0
- TPSA:
- 54.9
- CAS Number(s):
- 131219-97-1
Synonym(s)
1.
Tussicaps
External Link(s)
| PubChem Compound | 44146799 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 6 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 2 | Medication Error | FAERS: 6 | US FAERS | |
| 3 | Somnolence | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Accidental overdose | FAERS: 3 | US FAERS | |
| 5 | Dizziness | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 7 | Hypersensitivity | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 9 | Overdose | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 11 | Vomiting | FAERS: 3 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 12 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 13 | Constipation | FAERS: 2 | US FAERS | |
| 14 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 15 | Headache | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Product substitution issue | FAERS: 2 | US FAERS | |
| 17 | Pruritus | FAERS: 2 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 18 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 19 | Respiratory Depression | FAERS: 2 | US FAERS | |
| 20 | Toxicologic test abnormal | FAERS: 2 | US FAERS | |
| 21 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 22 | Aspergillosis | FAERS: 1 | US FAERS | |
| 23 | Blindness | FAERS: 1 | US FAERS | |
| 24 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 25 | Burning sensation | FAERS: 1 | US FAERS | |
| 26 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 27 | Choking | FAERS: 1 | US FAERS | |
| 28 | Chromaturia | FAERS: 1 | US FAERS | |
| 29 | Dehydration | FAERS: 1 | US FAERS | |
| 30 | Drug Dependence | FAERS: 1 | US FAERS | |
| 31 | Drug administration error | FAERS: 1 | US FAERS | |
| 32 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 33 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 34 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 35 | Drug level increased | FAERS: 1 | US FAERS | |
| 36 | Drug screen positive | FAERS: 1 | US FAERS | |
| 37 | Drug toxicity | FAERS: 1 | US FAERS | |
| 38 | Dysgeusia | FAERS: 1 | US FAERS | |
| 39 | Dysuria | FAERS: 1 | US FAERS | |
| 40 | Epistaxis | FAERS: 1 | US FAERS | |
| 41 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 42 | Malaise | FAERS: 1 | US FAERS | |
| 43 | Medication tampering | FAERS: 1 | US FAERS | |
| 44 | Multiple drug overdose | FAERS: 1 | US FAERS | |
| 45 | Nausea | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 46 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 47 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 48 | Pain | FAERS: 1 | US FAERS | |
| 49 | Palpitations | FAERS: 1 | US FAERS | |
| 50 | Petechiae | FAERS: 1 | US FAERS | |
| 51 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 52 | Poor weight gain neonatal | FAERS: 1 | US FAERS | |
| 53 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 54 | Restlessness | FAERS: 1 | US FAERS | |
| 55 | Sluggishness | FAERS: 1 | US FAERS | |
| 56 | Throat irritation | FAERS: 1 | US FAERS | |
| 57 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 58 | Urine ketone body present | FAERS: 1 | US FAERS | |
| 59 | Urticaria | FAERS: 1 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 60 | Victim of homicide | FAERS: 1 | US FAERS | |
| 61 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 62 | Asthenia | Canada Vigilance: 2 | Canada Vigilance | |
| 63 | Chest discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 64 | Chills | Canada Vigilance: 1 | Canada Vigilance | |
| 65 | Dermatitis | Canada Vigilance: 1 | Canada Vigilance | |
| 66 | Hearing disability | Canada Vigilance: 1 | Canada Vigilance | |
| 67 | Peripheral swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 68 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 69 | Product quality issue | Canada Vigilance: 2 | Canada Vigilance | |
| 70 | Respiratory Failure | Canada Vigilance: 1 | Canada Vigilance | |
| 71 | Rhinitis | Canada Vigilance: 1 | Canada Vigilance | |
| 72 | Syncope | Canada Vigilance: 1 | Canada Vigilance | |
| 73 | Tremor | Canada Vigilance: 2 | Canada Vigilance | |
| 74 | Vertigo | Canada Vigilance: 2 | Canada Vigilance | |
| 75 | Wrong technique in product usage process | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.