trolamine salicylate
(UEVAMYPIMMOEFW-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)c1ccccc1O.OCCN(CCO)CCO
- Type(s)
- Approved
- Molecular Formula:
- C13H21NO6
- Molecular Weight:
- 287.309
- Log P:
- -0.6443
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 5
- TPSA:
- 121.46
- CAS Number(s):
- 2174-16-5
Synonym(s)
1.
trolamine salicylate
2.
Myoflex
3.
triethanolamine salicylate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Back Pain | FAERS: 2 | US FAERS | |
| 2 | Drug Dependence | FAERS: 2 | US FAERS | |
| 3 | Erythema | FAERS: 2 | US FAERS | |
| 4 | Expired product administered | FAERS: 2 | US FAERS | |
| 5 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 6 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 7 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 8 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 9 | Bunion | FAERS: 1 | US FAERS | |
| 10 | Burning sensation | FAERS: 1 | US FAERS | |
| 11 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 12 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 13 | Extremity contracture | FAERS: 1 | US FAERS | |
| 14 | Eye irritation | FAERS: 1 | US FAERS | |
| 15 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 16 | Fracture | FAERS: 1 | US FAERS | |
| 17 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 18 | Inflammation | FAERS: 1 | US FAERS | |
| 19 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 20 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 21 | Laceration | FAERS: 1 | US FAERS | |
| 22 | Meniscus injury | FAERS: 1 | US FAERS | |
| 23 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 24 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 25 | Pain of skin | FAERS: 1 | US FAERS | |
| 26 | Pain | FAERS: 1 | US FAERS | |
| 27 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 28 | Pruritus | FAERS: 1 | US FAERS | |
| 29 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 30 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 31 | Thrombosis | FAERS: 1 | US FAERS | |
| 32 | Vomiting | FAERS: 1 | US FAERS | |
| 33 | Walking aid user | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120241
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.