Propoxyphene napsylate and acetaminophen
(TUDKHASXBPBVOK-VGHSCWAPSA-N)
Structure
- SMILES
- OS(=O)(=O)c1ccc2c(c1)cccc2.CC(=O)Nc1ccc(cc1)O.CCC(=O)O[C@](c1ccccc1)([C@@H](CN(C)C)C)Cc1ccccc1
- Molecular Formula:
- C40H46N2O7S
- Molecular Weight:
- 698.867
- Log P:
- 8.8664
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 3
- TPSA:
- 141.62
- CAS Number(s):
- 97626-31-8
Synonym(s)
1.
Propoxyphene napsylate and acetaminophen
External Link(s)
| PubChem Compound | 44150691 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Palpitations | FAERS: 22 | US FAERS | |
| 2 | Dizziness | FAERS: 18 | US FAERS | |
| 3 | Nausea | FAERS: 16 | US FAERS | |
| 4 | Chest Pain | FAERS: 15 | US FAERS | |
| 5 | Atrial Fibrillation | FAERS: 13 | US FAERS | |
| 6 | Drug ineffective | FAERS: 11 | US FAERS | |
| 7 | Myocardial Infarction | FAERS: 9 | US FAERS | |
| 8 | Cardiac Arrest | FAERS: 8 | US FAERS | |
| 9 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 10 | Completed Suicide | FAERS: 8 | US FAERS | |
| 11 | Pharmaceutical product complaint | FAERS: 6 | US FAERS | |
| 12 | Respiratory arrest | FAERS: 6 | US FAERS | |
| 13 | Asthenia | FAERS: 5 | US FAERS | |
| 14 | Headache | FAERS: 5 | US FAERS | |
| 15 | nervous system disorder | FAERS: 5 | US FAERS | |
| 16 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 17 | Blindness | FAERS: 4 | US FAERS | |
| 18 | Blood pressure inadequately controlled | FAERS: 4 | US FAERS | |
| 19 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 20 | Medication Error | FAERS: 4 | US FAERS | |
| 21 | Multiple drug overdose | FAERS: 4 | US FAERS | |
| 22 | Overdose | FAERS: 4 | US FAERS | |
| 23 | Syncope | FAERS: 4 | US FAERS | |
| 24 | Tachycardia | FAERS: 4 | US FAERS | |
| 25 | Therapeutic response unexpected with drug substitution | FAERS: 4 | US FAERS | |
| 26 | Vomiting | FAERS: 4 | US FAERS | |
| 27 | Anxiety | FAERS: 3 | US FAERS | |
| 28 | Atrial Flutter | FAERS: 3 | US FAERS | |
| 29 | Disorientation | FAERS: 3 | US FAERS | |
| 30 | Drug abuse | FAERS: 3 | US FAERS | |
| 31 | Fatigue | FAERS: 3 | US FAERS | |
| 32 | Presyncope | FAERS: 3 | US FAERS | |
| 33 | Product quality issue | FAERS: 3 | US FAERS | |
| 34 | Tremor | FAERS: 3 | US FAERS | |
| 35 | Urticaria | FAERS: 3 | US FAERS | |
| 36 | Ventricular Fibrillation | FAERS: 3 | US FAERS | |
| 37 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 38 | Atrial tachycardia | FAERS: 2 | US FAERS | |
| 39 | Back Pain | FAERS: 2 | US FAERS | |
| 40 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 41 | Chills | FAERS: 2 | US FAERS | |
| 42 | Constipation | FAERS: 2 | US FAERS | |
| 43 | Drug diversion | FAERS: 2 | US FAERS | |
| 44 | Inadequate analgesia | FAERS: 2 | US FAERS | |
| 45 | Mental status changes | FAERS: 2 | US FAERS | |
| 46 | Pain | FAERS: 2 | US FAERS | |
| 47 | Product substitution issue | FAERS: 2 | US FAERS | |
| 48 | Pruritus | FAERS: 2 | US FAERS | |
| 49 | Unevaluable event | FAERS: 2 | US FAERS | |
| 50 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 51 | Aneurysm | FAERS: 1 | US FAERS | |
| 52 | Anorexia | FAERS: 1 | US FAERS | |
| 53 | Anticholinergic Syndrome | FAERS: 1 | US FAERS | |
| 54 | Aphasia | FAERS: 1 | US FAERS | |
| 55 | Apparent death | FAERS: 1 | US FAERS | |
| 56 | Arthralgia | FAERS: 1 | US FAERS | |
| 57 | Back disorder | FAERS: 1 | US FAERS | |
| 58 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 59 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 60 | Bradycardia | FAERS: 1 | US FAERS | |
| 61 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 62 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 63 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 64 | Colectomy | FAERS: 1 | US FAERS | |
| 65 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 66 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 67 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 68 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 69 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 70 | Embolism | FAERS: 1 | US FAERS | |
| 71 | Eye pain | FAERS: 1 | US FAERS | |
| 72 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 73 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 74 | Formication | FAERS: 1 | US FAERS | |
| 75 | Hernia obstructive | FAERS: 1 | US FAERS | |
| 76 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 77 | Hypophagia | FAERS: 1 | US FAERS | |
| 78 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 79 | Joint swelling | FAERS: 1 | US FAERS | |
| 80 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 81 | Malaise | FAERS: 1 | US FAERS | |
| 82 | Memory impairment | FAERS: 1 | US FAERS | |
| 83 | Myalgia | FAERS: 1 | US FAERS | |
| 84 | Neuralgia | FAERS: 1 | US FAERS | |
| 85 | No adverse event | FAERS: 1 | US FAERS | |
| 86 | Pericardial Cyst | FAERS: 1 | US FAERS | |
| 87 | Postural Orthostatic Tachycardia Syndrome | FAERS: 1 | US FAERS | |
| 88 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 89 | Restlessness | FAERS: 1 | US FAERS | |
| 90 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 91 | Sneezing | FAERS: 1 | US FAERS | |
| 92 | Somnolence | FAERS: 1 | US FAERS | |
| 93 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 94 | Sudden death | FAERS: 1 | US FAERS | |
| 95 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 96 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 97 | Thrombosis | FAERS: 1 | US FAERS | |
| 98 | Ulcer | FAERS: 1 | US FAERS | |
| 99 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 100 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 101 | Visual Impairment | FAERS: 1 | US FAERS | |
| 102 | Visual disturbance | FAERS: 1 | US FAERS | |
| 103 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 104 | Walking aid user | FAERS: 1 | US FAERS | |
| 105 | heart rate | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.