retapamulin
(STZYTFJPGGDRJD-FJJJPKKESA-N)
Structure
- SMILES
- C=C[C@]1(C)C[C@@H](OC(=O)CSC2C[C@@H]3CC[C@H](C2)N3C)[C@]2(C)[C@H](C)CC[C@]3([C@H]([C@@H]1O)C)[C@H]2C(=O)CC3
- Type(s)
- Approved
- ATC code(s)
- D06AX13
- Molecular Formula:
- C30H47NO4S
- Molecular Weight:
- 517.763
- Log P:
- 5.1892
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 92.14
- CAS Number(s):
- 224452-66-8
Synonym(s)
1.
retapamulin
2.
Altabax
3.
SB 275833
4.
SB-275833
5.
SB275833
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Application site irritation | FAERS: 105 | OFFSIDES SIDER US FAERS | |
| 2 | Burning sensation | FAERS: 54 | OFFSIDES SIDER US FAERS | |
| 3 | Application site pain | FAERS: 37 | OFFSIDES SIDER US FAERS | |
| 4 | Pain | FAERS: 34 | OFFSIDES SIDER US FAERS | |
| 5 | Application site erythema | FAERS: 24 | OFFSIDES US FAERS | |
| 6 | Drug ineffective | FAERS: 23 | OFFSIDES US FAERS | |
| 7 | Erythema | FAERS: 20 | OFFSIDES SIDER US FAERS | |
| 8 | Skin irritation | FAERS: 18 | US FAERS | |
| 9 | Hypersensitivity | FAERS: 17 | SIDER US FAERS | |
| 10 | Crying | FAERS: 14 | OFFSIDES US FAERS | |
| 11 | Pruritus | FAERS: 14 | SIDER US FAERS | |
| 12 | Application site pruritus | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 13 | Screaming | FAERS: 10 | OFFSIDES US FAERS | |
| 14 | Swelling | FAERS: 9 | US FAERS | |
| 15 | Dermatitis | FAERS: 7 | US FAERS | |
| 16 | Thermal burn | FAERS: 6 | US FAERS | |
| 17 | Application site rash | FAERS: 4 | OFFSIDES US FAERS | |
| 18 | Cheilitis | FAERS: 4 | OFFSIDES US FAERS | |
| 19 | Infection | FAERS: 4 | US FAERS | |
| 20 | Lip swelling | FAERS: 4 | US FAERS | |
| 21 | Nasal discomfort | FAERS: 4 | OFFSIDES US FAERS | |
| 22 | Wound Complication | FAERS: 4 | OFFSIDES US FAERS | |
| 23 | Application site scar | FAERS: 3 | OFFSIDES US FAERS | |
| 24 | Application site swelling | FAERS: 3 | OFFSIDES US FAERS | |
| 25 | Application site vesicles | FAERS: 3 | OFFSIDES US FAERS | |
| 26 | Drug administered at inappropriate site | FAERS: 3 | OFFSIDES US FAERS | |
| 27 | Drug administration error | FAERS: 3 | OFFSIDES US FAERS | |
| 28 | Gaze palsy | FAERS: 3 | US FAERS | |
| 29 | Malaise | FAERS: 3 | US FAERS | |
| 30 | Medication Error | FAERS: 3 | US FAERS | |
| 31 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 32 | Urticaria | FAERS: 3 | US FAERS | |
| 33 | Angioedema | FAERS: 2 | SIDER US FAERS | |
| 34 | Application site abscess | FAERS: 2 | US FAERS | |
| 35 | Application site burn | FAERS: 2 | SIDER US FAERS | |
| 36 | Application site discomfort | FAERS: 2 | US FAERS | |
| 37 | Application site exfoliation | FAERS: 2 | OFFSIDES US FAERS | |
| 38 | Application site inflammation | FAERS: 2 | OFFSIDES US FAERS | |
| 39 | Application site reaction | FAERS: 2 | OFFSIDES US FAERS | |
| 40 | Cellulitis | FAERS: 2 | US FAERS | |
| 41 | Chills | FAERS: 2 | US FAERS | |
| 42 | Discomfort | FAERS: 2 | US FAERS | |
| 43 | Dysphonia | FAERS: 2 | US FAERS | |
| 44 | Ear discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 45 | Epistaxis | FAERS: 2 | US FAERS | |
| 46 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 47 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 48 | Inflammation | FAERS: 2 | US FAERS | |
| 49 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 50 | Wound Infection | FAERS: 2 | US FAERS | |
| 51 | Adverse event | FAERS: 1 | US FAERS | |
| 52 | Allergy test positive | FAERS: 1 | US FAERS | |
| 53 | Application site discharge | FAERS: 1 | OFFSIDES US FAERS | |
| 54 | Application site dryness | FAERS: 1 | US FAERS | |
| 55 | Application site excoriation | FAERS: 1 | OFFSIDES US FAERS | |
| 56 | Application site infection | FAERS: 1 | US FAERS | |
| 57 | Application site ulcer | FAERS: 1 | US FAERS | |
| 58 | Arthralgia | FAERS: 1 | US FAERS | |
| 59 | Auricular swelling | FAERS: 1 | US FAERS | |
| 60 | Conversion disorder | FAERS: 1 | US FAERS | |
| 61 | Deafness | FAERS: 1 | US FAERS | |
| 62 | Dizziness | FAERS: 1 | US FAERS | |
| 63 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 64 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 65 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 66 | Dry skin | FAERS: 1 | US FAERS | |
| 67 | Dysgeusia | FAERS: 1 | US FAERS | |
| 68 | Eczema | FAERS: 1 | SIDER US FAERS | |
| 69 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 70 | Headache | FAERS: 1 | SIDER US FAERS | |
| 71 | Impetigo | FAERS: 1 | OFFSIDES US FAERS | |
| 72 | Incision site complication | FAERS: 1 | US FAERS | |
| 73 | Induration | FAERS: 1 | US FAERS | |
| 74 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 75 | Myalgia | FAERS: 1 | US FAERS | |
| 76 | No adverse event | FAERS: 1 | US FAERS | |
| 77 | Open wound | FAERS: 1 | US FAERS | |
| 78 | Overdose | FAERS: 1 | US FAERS | |
| 79 | Palpitations | FAERS: 1 | US FAERS | |
| 80 | Postoperative wound complication | FAERS: 1 | OFFSIDES US FAERS | |
| 81 | Product quality issue | FAERS: 1 | US FAERS | |
| 82 | Purulent discharge | FAERS: 1 | US FAERS | |
| 83 | Rhinalgia | FAERS: 1 | US FAERS | |
| 84 | Scab | FAERS: 1 | US FAERS | |
| 85 | Shock | FAERS: 1 | US FAERS | |
| 86 | Skin lesion | FAERS: 1 | US FAERS | |
| 87 | Skin tightness | FAERS: 1 | US FAERS | |
| 88 | Tinnitus | FAERS: 1 | US FAERS | |
| 89 | Tremor | FAERS: 1 | US FAERS | |
| 90 | Vestibular function test abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 91 | Visual Impairment | FAERS: 1 | US FAERS | |
| 92 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 93 | Application site scab | OFFSIDES | ||
| 94 | Contact Dermatitis | OFFSIDES | ||
| 95 | Instillation site pain | SIDER | ||
| 96 | Nasopharyngitis | SIDER | ||
| 97 | Nausea | SIDER | ||
| 98 | Oropharyngeal blistering | OFFSIDES | ||
| 99 | Poor quality sleep | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.