Citrulline
(RHGKLRLOHDJJDR-BYPYZUCNSA-N)
Structure
- SMILES
- NC(=O)NCCC[C@@H](C(=O)O)N
- Type(s)
- Approved; Investigational; Nutraceutical
- Molecular Formula:
- C6H13N3O3
- Molecular Weight:
- 175.186
- Log P:
- 0.6383
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 4
- TPSA:
- 118.44
- CAS Number(s):
- 372-75-8
Synonym(s)
1.
Citrulline
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Product compounding quality issue | FAERS: 3 | US FAERS | |
| 2 | Alopecia | FAERS: 2 | US FAERS | |
| 3 | Ammonia increased | FAERS: 2 | US FAERS | |
| 4 | Drug ineffective | FAERS: 2 | US FAERS | |
| 5 | Drug level below therapeutic | FAERS: 2 | US FAERS | |
| 6 | Product quality issue | FAERS: 2 | US FAERS | |
| 7 | Asthenia | FAERS: 1 | US FAERS | |
| 8 | Drug level decreased | FAERS: 1 | US FAERS | |
| 9 | Dry skin | FAERS: 1 | US FAERS | |
| 10 | Fatigue | FAERS: 1 | US FAERS | |
| 11 | Mental status changes | FAERS: 1 | US FAERS | |
| 12 | Onychoclasis | FAERS: 1 | US FAERS | |
| 13 | Pallor | FAERS: 1 | US FAERS | |
| 14 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 15 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 16 | Swelling | FAERS: 1 | US FAERS | |
| 17 | Vomiting | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120262
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.