Sandostatin LAR Depot
(QWFYIFWTVZFPRY-AARKYNAGSA-N)
Structure
- SMILES
- CC(=O)O.CC(=O)O.NCCCCC1NC(=O)C(NC(=O)C(Cc2ccccc2)NC(=O)C(CSSCC(NC(=O)C(NC1=O)C(O)C)C(=O)N[C@@H]([C@H](O)C)CO)NC(=O)C(Cc1ccccc1)N)Cc1c[nH]c2c1cccc2
- Molecular Formula:
- C53H74N10O14S2
- Molecular Weight:
- 1139.340
- Log P:
- 3.2028
- Hydrogen Bond Acceptor:
- 25
- Hydrogen Bond Donor:
- 15
- TPSA:
- 457.42
- CAS Number(s):
- N/A
Synonym(s)
1.
Sandostatin LAR Depot
External Link(s)
| PubChem Compound | 54373 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 2 | US FAERS | |
| 2 | Malaise | FAERS: 2 | US FAERS | |
| 3 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 4 | Vomiting | FAERS: 2 | US FAERS | |
| 5 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 6 | Asthenia | FAERS: 1 | US FAERS | |
| 7 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 8 | Constipation | FAERS: 1 | US FAERS | |
| 9 | Disease Progression | FAERS: 1 | US FAERS | |
| 10 | Dizziness | FAERS: 1 | US FAERS | |
| 11 | Drug administration error | FAERS: 1 | US FAERS | |
| 12 | Dysuria | FAERS: 1 | US FAERS | |
| 13 | Early satiety | FAERS: 1 | US FAERS | |
| 14 | Feeling Cold | FAERS: 1 | US FAERS | |
| 15 | Flushing | FAERS: 1 | US FAERS | |
| 16 | Full blood count increased | FAERS: 1 | US FAERS | |
| 17 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 18 | Headache | FAERS: 1 | US FAERS | |
| 19 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 20 | Ileus | FAERS: 1 | US FAERS | |
| 21 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 22 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 23 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 24 | Mental impairment | FAERS: 1 | US FAERS | |
| 25 | Nausea | FAERS: 1 | US FAERS | |
| 26 | Nodule | FAERS: 1 | US FAERS | |
| 27 | Pain | FAERS: 1 | US FAERS | |
| 28 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 29 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 30 | Pruritus | FAERS: 1 | US FAERS | |
| 31 | Renal pain | FAERS: 1 | US FAERS | |
| 32 | Umbilical hernia | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120263
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.