3-O-Ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate;3-methyl-2-[pentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoic acid
(QWCYQCQLAZCPHO-UHFFFAOYSA-N)
Structure
- SMILES
- CCCCC(=O)N(C(C(=O)O)C(C)C)Cc1ccc(cc1)c1ccccc1c1n[nH]nn1.NCCOCC1=C(C(=O)OCC)C(C(=C(N1)C)C(=O)OC)c1ccccc1Cl
- Molecular Formula:
- C44H54ClN7O8
- Molecular Weight:
- 844.395
- Log P:
- 7.4571
- Hydrogen Bond Acceptor:
- 14
- Hydrogen Bond Donor:
- 4
- TPSA:
- 211.95
- CAS Number(s):
- N/A
Synonym(s)
1.
3-O-Ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate;3-methyl-2-[pentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoic acid
External Link(s)
| PubChem Compound | 139033603 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Asthenia | FAERS: 2 | US FAERS | |
| 2 | Dizziness | FAERS: 2 | US FAERS | |
| 3 | Product substitution issue | FAERS: 2 | US FAERS | |
| 4 | Angioedema | FAERS: 1 | US FAERS | |
| 5 | Arthralgia | FAERS: 1 | US FAERS | |
| 6 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 7 | Bone pain | FAERS: 1 | US FAERS | |
| 8 | Chest Pain | FAERS: 1 | US FAERS | |
| 9 | Cholecystitis | FAERS: 1 | US FAERS | |
| 10 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 11 | Drug ineffective | FAERS: 1 | US FAERS | |
| 12 | Headache | FAERS: 1 | US FAERS | |
| 13 | Myalgia | FAERS: 1 | US FAERS | |
| 14 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 15 | Secretion discharge | FAERS: 1 | US FAERS | |
| 16 | Somnolence | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120241
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.