Pentazocine
(QNLDTXPVZPRSAM-DTOXXUQYSA-N)
Structure
- SMILES
- OC(=O)C(O)C.CC(=CCN1CC[C@@]2([C@H]([C@H]1Cc1c2cc(cc1)O)C)C)C
- Molecular Formula:
- C22H33NO4
- Molecular Weight:
- 375.502
- Log P:
- 3.2723
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 3
- TPSA:
- 81
- CAS Number(s):
- 17146-95-1
Synonym(s)
1.
Pentazocine
2.
Fortral
3.
Lexir
4.
Pentazocine Hydrochloride
5.
Pentazocine Lactate
6.
Talwin
7.
Hydrochloride, Pentazocine
8.
Lactate, Pentazocine
External Link(s)
| MeSH | D010423 |
| PubChem Compound | 656697 |
| CHEMBL | CHEMBL1200327 |
| KEGG | dr:D02111 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Respiratory Depression | FAERS: 30 | US FAERS | |
| 2 | Drug abuse | FAERS: 18 | US FAERS | |
| 3 | Scleroderma | FAERS: 15 | US FAERS | |
| 4 | Skin Ulcer | FAERS: 10 | US FAERS | |
| 5 | Drug Dependence | FAERS: 7 | US FAERS | |
| 6 | Arteritis | FAERS: 3 | US FAERS | |
| 7 | Cellulitis | FAERS: 3 | US FAERS | |
| 8 | Drug withdrawal syndrome | FAERS: 3 | US FAERS | |
| 9 | Overdose | FAERS: 3 | US FAERS | |
| 10 | Venous Thrombosis | FAERS: 3 | US FAERS | |
| 11 | Amnesia | FAERS: 2 | US FAERS | |
| 12 | Completed Suicide | FAERS: 2 | US FAERS | |
| 13 | Dystonia | FAERS: 2 | US FAERS | |
| 14 | Eschar | FAERS: 2 | US FAERS | |
| 15 | Neonatal respiratory depression | FAERS: 2 | US FAERS | |
| 16 | Pneumonia | FAERS: 2 | US FAERS | |
| 17 | Swelling | FAERS: 2 | US FAERS | |
| 18 | Thrombosis | FAERS: 2 | US FAERS | |
| 19 | Ulcer | FAERS: 2 | US FAERS | |
| 20 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 21 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 22 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 23 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 24 | Back Pain | FAERS: 1 | US FAERS | |
| 25 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 26 | Calcinosis | FAERS: 1 | US FAERS | |
| 27 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 28 | Constipation | FAERS: 1 | US FAERS | |
| 29 | Depressed mood | FAERS: 1 | US FAERS | |
| 30 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 31 | Drug level below therapeutic | FAERS: 1 | US FAERS | |
| 32 | Dyspepsia | FAERS: 1 | US FAERS | |
| 33 | Dysuria | FAERS: 1 | US FAERS | |
| 34 | Fatigue | FAERS: 1 | US FAERS | |
| 35 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 36 | Injection site ulcer | FAERS: 1 | US FAERS | |
| 37 | Middle insomnia | FAERS: 1 | US FAERS | |
| 38 | Muscle fibrosis | FAERS: 1 | US FAERS | |
| 39 | Myopathy | FAERS: 1 | US FAERS | |
| 40 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 41 | Pain | FAERS: 1 | US FAERS | |
| 42 | Panniculitis | FAERS: 1 | US FAERS | |
| 43 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 44 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 45 | Shock | FAERS: 1 | US FAERS | |
| 46 | Skin Induration | FAERS: 1 | US FAERS | |
| 47 | Somnolence | FAERS: 1 | US FAERS | |
| 48 | Suicide attempt | FAERS: 1 | US FAERS | |
| 49 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 50 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 51 | Urine leukocyte esterase positive | FAERS: 1 | US FAERS | |
| 52 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.